2-hydroxy-3-(quinolin-2-yl)propenoic acid

ID: ALA4576771

PubChem CID: 136678191

Max Phase: Preclinical

Molecular Formula: C12H9NO3

Molecular Weight: 215.21

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)/C(O)=C/c1ccc2ccccc2n1

Standard InChI:  InChI=1S/C12H9NO3/c14-11(12(15)16)7-9-6-5-8-3-1-2-4-10(8)13-9/h1-7,14H,(H,15,16)/b11-7-

Standard InChI Key:  PQZOUJKJYOMYQY-XFFZJAGNSA-N

Molfile:  

 
     RDKit          2D

 16 17  0  0  0  0  0  0  0  0999 V2000
   28.7860  -27.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7849  -28.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4929  -28.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4911  -27.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1997  -27.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2005  -28.3729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9090  -28.7799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6173  -28.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6126  -27.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9034  -27.1436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3266  -28.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3298  -29.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0390  -29.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0422  -30.8152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7452  -29.5867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6236  -30.0035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 12 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4576771

    ---

Associated Targets(Human)

CA2 Tclin Carbonic anhydrase II (17698 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MMP2 Tchem Matrix metalloproteinase-2 (6627 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HEL-S-133P L-lactate dehydrogenase (161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 215.21Molecular Weight (Monoisotopic): 215.0582AlogP: 2.22#Rotatable Bonds: 2
Polar Surface Area: 70.42Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 2.65CX Basic pKa: 3.87CX LogP: 1.28CX LogD: -1.41
Aromatic Rings: 2Heavy Atoms: 16QED Weighted: 0.59Np Likeness Score: -0.11

References

1. Burkett DJ, Wyatt BN, Mews M, Bautista A, Engel R, Dockendorff C, Donaldson WA, St Maurice M..  (2019)  Evaluation of α-hydroxycinnamic acids as pyruvate carboxylase inhibitors.,  27  (18): [PMID:31351848] [10.1016/j.bmc.2019.07.027]

Source