3,5-diamino-6-(thiophen-2-yl)-N-carbamimidoylpyrazine-2-carboxamide

ID: ALA4576924

PubChem CID: 155553995

Max Phase: Preclinical

Molecular Formula: C10H11N7OS

Molecular Weight: 277.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(N)NC(=O)c1nc(-c2cccs2)c(N)nc1N

Standard InChI:  InChI=1S/C10H11N7OS/c11-7-5(4-2-1-3-19-4)15-6(8(12)16-7)9(18)17-10(13)14/h1-3H,(H4,11,12,16)(H4,13,14,17,18)

Standard InChI Key:  AUMPDTUFBAHAQZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
    5.7437  -18.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7425  -19.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4547  -19.7473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1685  -19.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1657  -18.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4529  -18.1017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8810  -19.7454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0304  -19.7464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8760  -18.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5893  -18.5058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8729  -17.2744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2996  -18.0904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0130  -18.5004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2965  -17.2691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0338  -18.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9488  -17.2858    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.1473  -17.1156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7390  -17.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2842  -18.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 12 14  2  0
  1 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4576924

    ---

Associated Targets(Human)

PLAU Tchem Urokinase-type plasminogen activator (2016 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 277.31Molecular Weight (Monoisotopic): 277.0746AlogP: -0.01#Rotatable Bonds: 2
Polar Surface Area: 156.79Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 8#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.81CX Basic pKa: 6.91CX LogP: 0.49CX LogD: 0.37
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.38Np Likeness Score: -0.95

References

1. Buckley BJ, Majed H, Aboelela A, Minaei E, Jiang L, Fildes K, Cheung CY, Johnson D, Bachovchin D, Cook GM, Huang M, Ranson M, Kelso MJ..  (2019)  6-Substituted amiloride derivatives as inhibitors of the urokinase-type plasminogen activator for use in metastatic disease.,  29  (24): [PMID:31679971] [10.1016/j.bmcl.2019.126753]

Source