N-(5-(2,3-dimethylphenyl)-1,2,3,4-tetrahydro-1,6-naphthyridin-7-yl)isobutyramide

ID: ALA4577002

PubChem CID: 155554003

Max Phase: Preclinical

Molecular Formula: C20H25N3O

Molecular Weight: 323.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(-c2nc(NC(=O)C(C)C)cc3c2CCCN3)c1C

Standard InChI:  InChI=1S/C20H25N3O/c1-12(2)20(24)23-18-11-17-16(9-6-10-21-17)19(22-18)15-8-5-7-13(3)14(15)4/h5,7-8,11-12,21H,6,9-10H2,1-4H3,(H,22,23,24)

Standard InChI Key:  XAMZGAGTSQZVPO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   27.9812   -2.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9800   -3.7003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6881   -4.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6863   -2.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3940   -2.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3937   -3.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1008   -4.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8128   -3.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8131   -2.8817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1014   -2.4686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6897   -4.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9802   -5.3321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9796   -6.1485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6877   -6.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3979   -6.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3951   -5.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2734   -2.4723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5658   -2.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5660   -3.6983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2731   -4.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2716   -6.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8580   -2.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8578   -1.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1504   -2.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  3 11  1  0
  1 17  1  0
 17 18  1  0
 18 19  2  0
 12 20  1  0
 13 21  1  0
 18 22  1  0
 22 23  1  0
 22 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4577002

    ---

Associated Targets(Human)

NUDT1 Tchem 7,8-dihydro-8-oxoguanine triphosphatase (280 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 323.44Molecular Weight (Monoisotopic): 323.1998AlogP: 4.32#Rotatable Bonds: 3
Polar Surface Area: 54.02Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.10CX Basic pKa: 7.34CX LogP: 4.85CX LogD: 4.58
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.88Np Likeness Score: -0.75

References

1. Farand J, Kropf JE, Blomgren P, Xu J, Schmitt AC, Newby ZE, Wang T, Murakami E, Barauskas O, Sudhamsu J, Feng JY, Niedziela-Majka A, Schultz BE, Schwartz K, Viatchenko-Karpinski S, Kornyeyev D, Kashishian A, Fan P, Chen X, Lansdon EB, Ports MO, Currie KS, Watkins WJ, Notte GT..  (2020)  Discovery of Potent and Selective MTH1 Inhibitors for Oncology: Enabling Rapid Target (In)Validation.,  11  (3): [PMID:32184970] [10.1021/acsmedchemlett.9b00420]

Source