The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(1,2-Cyclohexadiyl)bis(4-nitrobenzamide) ID: ALA4577112
PubChem CID: 3379821
Max Phase: Preclinical
Molecular Formula: C20H20N4O6
Molecular Weight: 412.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CCCCC1NC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C20H20N4O6/c25-19(13-5-9-15(10-6-13)23(27)28)21-17-3-1-2-4-18(17)22-20(26)14-7-11-16(12-8-14)24(29)30/h5-12,17-18H,1-4H2,(H,21,25)(H,22,26)
Standard InChI Key: IFJNBTSLUHNFGX-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
31.5604 -26.1967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2696 -26.6027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9758 -26.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2727 -27.4199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6822 -26.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3879 -26.1889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3852 -25.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6710 -24.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9682 -25.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0908 -24.9586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8006 -25.3636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0867 -24.1415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3126 -25.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3114 -26.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0195 -26.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7291 -26.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7263 -25.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0177 -24.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6034 -26.6306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8960 -26.2215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6028 -27.4478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4325 -24.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1417 -25.3941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4294 -24.1710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1448 -26.2113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4381 -26.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4392 -27.4296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1466 -27.8394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8546 -27.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8551 -26.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 3 1 0
7 10 1 0
10 11 1 0
10 12 2 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
14 19 1 0
19 20 1 0
19 21 2 0
17 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 1 1 0
M CHG 4 10 1 11 -1 19 1 20 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.40Molecular Weight (Monoisotopic): 412.1383AlogP: 2.97#Rotatable Bonds: 6Polar Surface Area: 144.48Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.49CX Basic pKa: ┄CX LogP: 3.22CX LogD: 3.22Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: -0.71
References 1. Güngör T, Önder FC, Tokay E, Gülhan ÜG, Hacıoğlu N, Tok TT, Çelik A, Köçkar F, Ay M.. (2019) PRODRUGS FOR NITROREDUCTASE BASED CANCER THERAPY- 2: Novel amide/Ntr combinations targeting PC3 cancer cells., 171 [PMID:30928710 ] [10.1016/j.ejmech.2019.03.035 ]