The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((R)-1-(2,4-Dichlorophenyl)ethyl)-3-methyl-6-((3R,4S)-3-methyl-4-((S)-2-methylpyrrolidin-1-yl)piperidin-1-yl)-1H-pyrazolo[3,4-b]pyrazine ID: ALA4577319
PubChem CID: 134325276
Max Phase: Preclinical
Molecular Formula: C25H32Cl2N6
Molecular Weight: 487.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn([C@H](C)c2ccc(Cl)cc2Cl)c2nc(N3CC[C@H](N4CCC[C@@H]4C)[C@H](C)C3)cnc12
Standard InChI: InChI=1S/C25H32Cl2N6/c1-15-14-31(11-9-22(15)32-10-5-6-16(32)2)23-13-28-24-17(3)30-33(25(24)29-23)18(4)20-8-7-19(26)12-21(20)27/h7-8,12-13,15-16,18,22H,5-6,9-11,14H2,1-4H3/t15-,16+,18-,22+/m1/s1
Standard InChI Key: MHYORVPBRVOLMW-IRMTXWDGSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
16.7360 -6.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4462 -6.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1632 -6.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1687 -5.2903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4508 -4.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7317 -5.2841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8855 -4.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6022 -5.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3225 -4.8892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8884 -4.0535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6058 -3.6430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3253 -4.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9412 -3.5006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6024 -2.7428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7771 -2.8310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2241 -2.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4778 -1.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4174 -2.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8664 -1.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0605 -1.9484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8061 -2.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3640 -3.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1679 -3.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9997 -2.9081 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.1220 -0.9918 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.0225 -6.5221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4403 -7.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7484 -3.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2671 -6.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7156 -6.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1274 -7.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9333 -7.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0949 -5.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
4 7 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 1 0
15 16 1 0
16 17 1 1
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
19 25 1 0
1 26 1 1
2 27 1 1
13 28 1 0
26 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 26 1 0
29 33 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.48Molecular Weight (Monoisotopic): 486.2066AlogP: 5.75#Rotatable Bonds: 4Polar Surface Area: 50.08Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.31CX LogP: 5.25CX LogD: 2.44Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -1.04
References 1. Jackson JJ, Ketcham JM, Younai A, Abraham B, Biannic B, Beck HP, Bui MHT, Chian D, Cutler G, Diokno R, Hu DX, Jacobson S, Karbarz E, Kassner PD, Marshall L, McKinnell J, Meleza C, Okal A, Pookot D, Reilly MK, Robles O, Shunatona HP, Talay O, Walker JR, Wadsworth A, Wustrow DJ, Zibinsky M.. (2019) Discovery of a Potent and Selective CCR4 Antagonist That Inhibits Treg Trafficking into the Tumor Microenvironment., 62 (13): [PMID:31259550 ] [10.1021/acs.jmedchem.9b00506 ]