The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(2-(4-chlorophenylsulfonyl)ethylthio)phenylcarbamoyl)benzoic acid ID: ALA4577370
PubChem CID: 2812659
Max Phase: Preclinical
Molecular Formula: C22H18ClNO5S2
Molecular Weight: 475.98
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccccc1C(=O)Nc1ccccc1SCCS(=O)(=O)c1ccc(Cl)cc1
Standard InChI: InChI=1S/C22H18ClNO5S2/c23-15-9-11-16(12-10-15)31(28,29)14-13-30-20-8-4-3-7-19(20)24-21(25)17-5-1-2-6-18(17)22(26)27/h1-12H,13-14H2,(H,24,25)(H,26,27)
Standard InChI Key: PLOUDMZGNRUCIY-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
10.7494 -7.2038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1662 -7.9205 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.5784 -7.2013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7525 -8.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7513 -9.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4661 -9.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1825 -9.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1797 -8.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4644 -7.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8977 -9.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8989 -10.4169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6114 -9.1783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3265 -9.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3231 -10.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0373 -10.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7521 -10.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7482 -9.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0334 -9.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0278 -8.3490 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.7394 -7.9317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4567 -8.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8854 -8.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8855 -9.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6019 -9.5624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3146 -9.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3063 -8.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5894 -7.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0323 -9.5518 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.4660 -10.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7513 -10.8312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1803 -10.8315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
6 29 1 0
29 30 1 0
29 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.98Molecular Weight (Monoisotopic): 475.0315AlogP: 4.86#Rotatable Bonds: 8Polar Surface Area: 100.54Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.91CX Basic pKa: ┄CX LogP: 4.49CX LogD: 1.01Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -1.67
References 1. (2017) Inhibitors of grb2-associated binding protein 1 (gab1) and methods of treating cancer using the same,