5-(Isonicotinamido)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic acid

ID: ALA4577585

PubChem CID: 155564566

Max Phase: Preclinical

Molecular Formula: C24H23N3O3

Molecular Weight: 401.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(NC(=O)c2ccncc2)cc(-c2ccc(C3CCNCC3)cc2)c1

Standard InChI:  InChI=1S/C24H23N3O3/c28-23(19-7-11-26-12-8-19)27-22-14-20(13-21(15-22)24(29)30)17-3-1-16(2-4-17)18-5-9-25-10-6-18/h1-4,7-8,11-15,18,25H,5-6,9-10H2,(H,27,28)(H,29,30)

Standard InChI Key:  FJEFSXQLZKHOJS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    6.3710   -4.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3699   -5.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0779   -5.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7876   -5.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7848   -4.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0761   -3.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0796   -6.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3702   -6.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3696   -7.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0778   -7.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7879   -7.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7850   -6.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0823   -8.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3732   -9.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3721   -9.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0785  -10.3227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7876   -9.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7903   -9.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4909   -3.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2002   -4.1884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4878   -2.9653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6632   -3.7889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9556   -4.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2478   -3.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9558   -5.0149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2512   -2.9715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5443   -2.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8357   -2.9719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8385   -3.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5461   -4.1980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  2  0
 19 21  1  0
  1 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4577585

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.47Molecular Weight (Monoisotopic): 401.1739AlogP: 4.17#Rotatable Bonds: 5
Polar Surface Area: 91.32Molecular Species: ZWITTERIONHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.85CX Basic pKa: 10.07CX LogP: 0.79CX LogD: 0.78
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: -0.84

References

1. Zhang Z, Hao K, Li H, Lu R, Liu C, Zhou M, Li B, Meng Z, Hu Q, Jiang C..  (2019)  Design, synthesis and anti-inflammatory evaluation of 3-amide benzoic acid derivatives as novel P2Y14 receptor antagonists.,  181  [PMID:31376563] [10.1016/j.ejmech.2019.111564]

Source