The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1-(anilinocarbonyl)-2-methylpropyl]-2-[(4-methoxybenzoyl)amino]benzamide ID: ALA4577661
Cas Number: 345237-92-5
PubChem CID: 2868215
Max Phase: Preclinical
Molecular Formula: C26H27N3O4
Molecular Weight: 445.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)Nc2ccccc2C(=O)NC(C(=O)Nc2ccccc2)C(C)C)cc1
Standard InChI: InChI=1S/C26H27N3O4/c1-17(2)23(26(32)27-19-9-5-4-6-10-19)29-25(31)21-11-7-8-12-22(21)28-24(30)18-13-15-20(33-3)16-14-18/h4-17,23H,1-3H3,(H,27,32)(H,28,30)(H,29,31)
Standard InChI Key: XVIULLVMDNLWKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
4.8908 -6.4096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5985 -6.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3062 -6.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5985 -5.1838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3062 -7.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0139 -7.6354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5985 -7.6354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0139 -6.0010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7216 -6.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4293 -6.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7216 -7.2268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1831 -6.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1880 -5.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4811 -4.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7724 -5.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7750 -6.0043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4825 -6.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1358 -6.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8430 -6.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8435 -5.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1308 -4.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4265 -5.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1335 -7.2310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8401 -7.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8378 -8.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5489 -7.2350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1271 -8.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1245 -9.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8316 -10.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5428 -9.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5419 -8.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8304 -10.9053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1220 -11.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
5 7 1 0
3 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
1 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 10 1 0
18 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
29 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.52Molecular Weight (Monoisotopic): 445.2002AlogP: 4.34#Rotatable Bonds: 8Polar Surface Area: 96.53Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.29CX Basic pKa: ┄CX LogP: 5.00CX LogD: 5.00Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -1.18
References 1. (2018) HTS Assay for Identifying Small Molecule Inhibitors of RAD52 and Uses of Identified Small Molecule Inhibitors for Treatment and Prevention of BRCA-Deficient Malignancies,