1-(1-Benzoylpiperidin-4-yl)-8,9-dihydro-2,4,7,9a-tetraazabenzo[cd]azulen-6(7H)-one

ID: ALA4578024

PubChem CID: 155564913

Max Phase: Preclinical

Molecular Formula: C21H21N5O2

Molecular Weight: 375.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NCCn2c(C3CCN(C(=O)c4ccccc4)CC3)nc3cncc1c32

Standard InChI:  InChI=1S/C21H21N5O2/c27-20-16-12-22-13-17-18(16)26(11-8-23-20)19(24-17)14-6-9-25(10-7-14)21(28)15-4-2-1-3-5-15/h1-5,12-14H,6-11H2,(H,23,27)

Standard InChI Key:  NAMYMUZIXBSMOZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    8.8404   -7.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3561   -7.7262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5789   -7.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5789   -6.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8698   -6.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7789   -5.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3573   -4.8485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1704   -4.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6143   -5.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3561   -6.3997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1566   -6.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1566   -7.4716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8698   -7.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0037   -5.1556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3002   -7.0630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8916   -7.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0703   -7.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6617   -7.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0703   -6.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8916   -6.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1215   -7.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5301   -6.3539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5301   -7.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1178   -8.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5257   -9.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3449   -9.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7546   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3443   -7.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 10  1  0
  4 10  1  0
 11 12  2  0
 12 13  1  0
  3 13  2  0
  5 11  1  0
  6 14  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 20  1  0
 21 22  2  0
 21 23  1  0
 15 21  1  0
  1 18  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4578024

    ---

Associated Targets(Human)

PARP2 Tclin Poly [ADP-ribose] polymerase 2 (1185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PARP1 Tclin Poly [ADP-ribose] polymerase-1 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.43Molecular Weight (Monoisotopic): 375.1695AlogP: 2.19#Rotatable Bonds: 2
Polar Surface Area: 80.12Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.14CX LogP: 0.86CX LogD: 0.86
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.74Np Likeness Score: -0.99

References

1. Li H, Hu Y, Wang X, He G, Xu Y, Zhu Q..  (2016)  Novel tricyclic poly (ADP-ribose) polymerase-1/2 inhibitors with potent anticancer chemopotentiating activity: Design, synthesis and biological evaluation.,  24  (19): [PMID:27561983] [10.1016/j.bmc.2016.08.016]

Source