The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(2-Butyramidoethyl)-4-(2-(2-hydroxy-3-(isopropylamino)propoxy)phenyl)butanamide ID: ALA4578042
PubChem CID: 155564992
Max Phase: Preclinical
Molecular Formula: C22H37N3O4
Molecular Weight: 407.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(=O)NCCNC(=O)CCCc1ccccc1OC[C@@H](O)CNC(C)C
Standard InChI: InChI=1S/C22H37N3O4/c1-4-8-21(27)23-13-14-24-22(28)12-7-10-18-9-5-6-11-20(18)29-16-19(26)15-25-17(2)3/h5-6,9,11,17,19,25-26H,4,7-8,10,12-16H2,1-3H3,(H,23,27)(H,24,28)/t19-/m0/s1
Standard InChI Key: HDOJMOVNRKPOTJ-IBGZPJMESA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
1.1111 -25.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1099 -25.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8248 -26.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5411 -25.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5383 -25.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8229 -24.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8204 -23.7702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5337 -23.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5312 -22.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2445 -22.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8155 -22.1203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2511 -24.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2419 -21.2911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9552 -20.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9528 -20.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6709 -21.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9672 -24.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6801 -24.5838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3961 -24.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1091 -24.5785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8250 -24.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5380 -24.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2539 -24.9829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3992 -25.8186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9669 -24.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6828 -24.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9637 -23.7427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3958 -24.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1117 -24.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 1
5 12 1 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
12 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
19 24 2 0
23 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.56Molecular Weight (Monoisotopic): 407.2784AlogP: 1.78#Rotatable Bonds: 15Polar Surface Area: 99.69Molecular Species: BASEHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.67CX LogP: 1.70CX LogD: -0.52Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: -0.55
References 1. Gaiser BI, Danielsen M, Marcher-Rørsted E, Røpke Jørgensen K, Wróbel TM, Frykman M, Johansson H, Bräuner-Osborne H, Gloriam DE, Mathiesen JM, Sejer Pedersen D.. (2019) Probing the Existence of a Metastable Binding Site at the β2 -Adrenergic Receptor with Homobivalent Bitopic Ligands., 62 (17): [PMID:31298548 ] [10.1021/acs.jmedchem.9b00595 ]