N-(4-((2-Amino-3-chloropyridin-4-yl)oxy)-3-fluorophenyl)-1-(3,5-dimethylphenyl)-2-oxo-1,2-dihydroquinoline-3-carboxamide

ID: ALA4578460

PubChem CID: 155564649

Max Phase: Preclinical

Molecular Formula: C29H22ClFN4O3

Molecular Weight: 528.97

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)cc(-n2c(=O)c(C(=O)Nc3ccc(Oc4ccnc(N)c4Cl)c(F)c3)cc3ccccc32)c1

Standard InChI:  InChI=1S/C29H22ClFN4O3/c1-16-11-17(2)13-20(12-16)35-23-6-4-3-5-18(23)14-21(29(35)37)28(36)34-19-7-8-24(22(31)15-19)38-25-9-10-33-27(32)26(25)30/h3-15H,1-2H3,(H2,32,33)(H,34,36)

Standard InChI Key:  WFEDMZOLLSFUBA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   10.1813   -7.7140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4745   -7.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4749   -6.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1863   -6.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8931   -6.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6003   -6.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3071   -6.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3067   -7.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5953   -7.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8885   -7.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7722   -6.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7727   -5.2587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0609   -6.4805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1767   -8.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8835   -8.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8790   -9.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1717  -10.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4649   -9.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4654   -8.9358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7631   -7.7102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3541   -6.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6468   -6.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9400   -6.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9405   -5.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6518   -4.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3586   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2328   -6.4729    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.2337   -4.8386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1124   -5.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8196   -4.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5264   -5.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5260   -6.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8146   -6.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1078   -6.0566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8242   -4.0135    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.4056   -4.8269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5847  -10.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7561  -10.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 10  1  0
  5 10  2  0
 11 12  2  0
 11 13  1  0
  3 11  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
  1 14  1  0
  2 20  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 23 27  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 29 34  2  0
 30 35  1  0
 29 36  1  0
 28 31  1  0
 24 28  1  0
 13 21  1  0
 16 37  1  0
 18 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4578460

    ---

Associated Targets(Human)

EBC-1 (148 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MET Tclin Hepatocyte growth factor receptor (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.97Molecular Weight (Monoisotopic): 528.1364AlogP: 6.42#Rotatable Bonds: 5
Polar Surface Area: 99.24Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.13CX Basic pKa: 5.97CX LogP: 5.96CX LogD: 5.95
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.33

References

1. Cui H, Peng X, Liu J, Ma C, Ji Y, Zhang W, Geng M, Li Y..  (2016)  Design, synthesis and biological evaluation of c-Met kinase inhibitors bearing 2-oxo-1,2-dihydroquinoline scaffold.,  26  (18): [PMID:27524312] [10.1016/j.bmcl.2016.07.077]

Source