The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((2-Amino-3-chloropyridin-4-yl)oxy)-3-fluorophenyl)-1-(3,5-dimethylphenyl)-2-oxo-1,2-dihydroquinoline-3-carboxamide ID: ALA4578460
PubChem CID: 155564649
Max Phase: Preclinical
Molecular Formula: C29H22ClFN4O3
Molecular Weight: 528.97
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)cc(-n2c(=O)c(C(=O)Nc3ccc(Oc4ccnc(N)c4Cl)c(F)c3)cc3ccccc32)c1
Standard InChI: InChI=1S/C29H22ClFN4O3/c1-16-11-17(2)13-20(12-16)35-23-6-4-3-5-18(23)14-21(29(35)37)28(36)34-19-7-8-24(22(31)15-19)38-25-9-10-33-27(32)26(25)30/h3-15H,1-2H3,(H2,32,33)(H,34,36)
Standard InChI Key: WFEDMZOLLSFUBA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
10.1813 -7.7140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4745 -7.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4749 -6.4843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1863 -6.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8931 -6.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6003 -6.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3071 -6.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3067 -7.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5953 -7.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8885 -7.3093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7722 -6.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7727 -5.2587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0609 -6.4805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1767 -8.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8835 -8.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8790 -9.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1717 -10.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4649 -9.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4654 -8.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7631 -7.7102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3541 -6.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6468 -6.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9400 -6.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9405 -5.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6518 -4.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3586 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2328 -6.4729 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2337 -4.8386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1124 -5.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8196 -4.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5264 -5.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5260 -6.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8146 -6.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1078 -6.0566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8242 -4.0135 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.4056 -4.8269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5847 -10.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7561 -10.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
11 13 1 0
3 11 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
1 14 1 0
2 20 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
21 26 2 0
23 27 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 2 0
30 35 1 0
29 36 1 0
28 31 1 0
24 28 1 0
13 21 1 0
16 37 1 0
18 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.97Molecular Weight (Monoisotopic): 528.1364AlogP: 6.42#Rotatable Bonds: 5Polar Surface Area: 99.24Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.13CX Basic pKa: 5.97CX LogP: 5.96CX LogD: 5.95Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.33
References 1. Cui H, Peng X, Liu J, Ma C, Ji Y, Zhang W, Geng M, Li Y.. (2016) Design, synthesis and biological evaluation of c-Met kinase inhibitors bearing 2-oxo-1,2-dihydroquinoline scaffold., 26 (18): [PMID:27524312 ] [10.1016/j.bmcl.2016.07.077 ]