6-(2-Isopropoxyphenyl)-N4,N4-bis(pyridin-2-ylmethyl)-pyrimidine-2,4-diamine

ID: ALA4578541

PubChem CID: 155565097

Max Phase: Preclinical

Molecular Formula: C25H26N6O

Molecular Weight: 426.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)Oc1ccccc1-c1cc(N(Cc2ccccn2)Cc2ccccn2)nc(N)n1

Standard InChI:  InChI=1S/C25H26N6O/c1-18(2)32-23-12-4-3-11-21(23)22-15-24(30-25(26)29-22)31(16-19-9-5-7-13-27-19)17-20-10-6-8-14-28-20/h3-15,18H,16-17H2,1-2H3,(H2,26,29,30)

Standard InChI Key:  YUDGAQFNCLUPQK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   23.9406  -27.2686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9395  -28.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6475  -28.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3572  -28.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3544  -27.2650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6457  -26.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2315  -28.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5257  -28.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8181  -28.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8170  -29.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5294  -29.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2340  -29.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5275  -27.2684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8207  -26.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0655  -28.4951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0668  -29.3123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7767  -28.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3598  -29.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4810  -28.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6545  -29.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9479  -29.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9487  -30.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6621  -30.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3657  -30.5338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4776  -29.3085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1851  -29.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8932  -29.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8893  -28.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1812  -28.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6433  -26.0425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8226  -26.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1121  -27.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  8 13  1  0
 13 14  1  0
  4 15  1  0
 15 16  1  0
 15 17  1  0
 16 18  1  0
 17 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 18  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 19  1  0
  6 30  1  0
 14 31  1  0
 14 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4578541

    ---

Associated Targets(Human)

CHRNB2 Tclin Neuronal acetylcholine receptor; alpha4/beta2 (3972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR3A Tclin Serotonin 3a (5-HT3a) receptor (3366 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CHRNA7 Tchem Neuronal acetylcholine receptor protein alpha-7 subunit (3524 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.52Molecular Weight (Monoisotopic): 426.2168AlogP: 4.51#Rotatable Bonds: 8
Polar Surface Area: 90.05Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.05CX LogP: 4.43CX LogD: 4.41
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.14

References

1. Camacho-Hernandez GA, Stokes C, Duggan BM, Kaczanowska K, Brandao-Araiza S, Doan L, Papke RL, Taylor P..  (2019)  Synthesis, Pharmacological Characterization, and Structure-Activity Relationships of Noncanonical Selective Agonists for α7 nAChRs.,  62  (22): [PMID:31675224] [10.1021/acs.jmedchem.9b01467]

Source