(4Z,7Z,10Z,13Z,16Z,19Z)-N-(4-Carboxyphenylsulfonyl)docosa-4,7,10,13,16,19-hexaenamide

ID: ALA4578660

PubChem CID: 155564727

Max Phase: Preclinical

Molecular Formula: C29H37NO5S

Molecular Weight: 511.68

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NS(=O)(=O)c1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C29H37NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-28(31)30-36(34,35)27-24-22-26(23-25-27)29(32)33/h3-4,6-7,9-10,12-13,15-16,18-19,22-25H,2,5,8,11,14,17,20-21H2,1H3,(H,30,31)(H,32,33)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-

Standard InChI Key:  RTFPMGHJFABWCZ-KUBAVDMBSA-N

Molfile:  

 
     RDKit          2D

 36 36  0  0  0  0  0  0  0  0999 V2000
    6.4426   -5.6378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0381   -4.9320    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6292   -5.6352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4620   -4.9403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1739   -4.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8816   -4.9403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5934   -4.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7502   -4.5276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4620   -5.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3019   -4.9349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3034   -5.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0118   -6.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0133   -6.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3064   -7.3864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3079   -8.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6009   -8.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8925   -8.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1855   -8.6161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4770   -8.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4755   -7.3916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7671   -6.9843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0601   -7.3942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0616   -8.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3547   -8.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3530   -9.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0599   -9.8449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7684   -9.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3348   -4.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3414   -3.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6353   -3.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9259   -3.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9270   -4.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6337   -4.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2184   -3.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2188   -2.4796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5105   -3.7051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  4  8  1  0
  4  9  2  0
  7 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
  8  2  1  0
  2 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
 34 35  2  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4578660

    ---

Associated Targets(non-human)

RBL-2H3 (1162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.68Molecular Weight (Monoisotopic): 511.2392AlogP: 6.67#Rotatable Bonds: 17
Polar Surface Area: 100.54Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.44CX Basic pKa: CX LogP: 7.20CX LogD: 2.90
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: 0.20

References

1. Kim IH, Kanayama Y, Nishiwaki H, Sugahara T, Nishi K..  (2019)  Structure-Activity Relationships of Fish Oil Derivatives with Antiallergic Activity in Vitro and in Vivo.,  62  (21): [PMID:31618024] [10.1021/acs.jmedchem.9b00994]

Source