2-((5aS,6S,8S,9aR)-6-acetoxy-5a-methyl-1,10-dioxo-3-(pyridin-3-yl)-1,5a,6,7,8,9,9a,10-octahydropyrano[4,3-b]chromen-8-yl)propane-1,3-diyl diacetate

ID: ALA4578690

PubChem CID: 134188242

Max Phase: Preclinical

Molecular Formula: C27H29NO10

Molecular Weight: 527.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OCC(COC(C)=O)[C@@H]1C[C@H](OC(C)=O)[C@@]2(C)Oc3cc(-c4cccnc4)oc(=O)c3C(=O)[C@@H]2C1

Standard InChI:  InChI=1S/C27H29NO10/c1-14(29)34-12-19(13-35-15(2)30)18-8-20-25(32)24-22(38-27(20,4)23(9-18)36-16(3)31)10-21(37-26(24)33)17-6-5-7-28-11-17/h5-7,10-11,18-20,23H,8-9,12-13H2,1-4H3/t18-,20-,23-,27-/m0/s1

Standard InChI Key:  VDYBSZGQMYVQPJ-LRHYNZNCSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    6.1212  -16.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5454  -17.3552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8333  -16.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5436  -16.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2582  -16.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2688  -15.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5585  -14.8861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8376  -15.2908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8333  -17.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1212  -17.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4155  -17.7654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4156  -18.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1277  -18.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8396  -18.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1268  -14.8720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4055  -16.1198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7017  -18.9993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5559  -18.9916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9866  -18.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7029  -19.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9853  -17.7628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2702  -17.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2688  -16.5263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5563  -17.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9890  -20.2380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2739  -19.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5600  -20.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2727  -19.0015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8254  -16.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1171  -18.1803    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9867  -14.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6968  -15.3249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4154  -14.9212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4254  -14.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7106  -13.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9948  -14.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5594  -19.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2756  -20.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8466  -20.2322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  1  3  1  0
  9  2  1  0
  2  4  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  8 15  2  0
  1 16  2  0
 12 17  1  1
 14 18  1  1
 17 19  1  0
 17 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
  9 29  1  1
 10 30  1  6
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
  6 31  1  0
 18 37  1  0
 37 38  1  0
 37 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4578690

    ---

Associated Targets(Human)

SOAT2 Tchem Acyl coenzyme A:cholesterol acyltransferase 2 (288 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.53Molecular Weight (Monoisotopic): 527.1791AlogP: 2.74#Rotatable Bonds: 7
Polar Surface Area: 148.30Molecular Species: NEUTRALHBA: 11HBD:
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.21CX LogP: 0.65CX LogD: 0.65
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.39Np Likeness Score: 1.28

References

1.  (2016)  Class of tricyclic analogue, preparation method and use thereof, 

Source