(S)-3-cyclopentyl-5-fluoro-2-(1-(2-fluoro-9H-purin-6-yl)pyrrolidin-2-yl)quinazolin-4(3H)-one

ID: ALA4578696

PubChem CID: 155564883

Max Phase: Preclinical

Molecular Formula: C22H21F2N7O

Molecular Weight: 437.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1c2c(F)cccc2nc([C@@H]2CCCN2c2nc(F)nc3[nH]cnc23)n1C1CCCC1

Standard InChI:  InChI=1S/C22H21F2N7O/c23-13-7-3-8-14-16(13)21(32)31(12-5-1-2-6-12)19(27-14)15-9-4-10-30(15)20-17-18(26-11-25-17)28-22(24)29-20/h3,7-8,11-12,15H,1-2,4-6,9-10H2,(H,25,26,28,29)/t15-/m0/s1

Standard InChI Key:  HAUBGVVGFGEVPH-HNNXBMFYSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   13.0311  -18.0516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8066  -18.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3073  -17.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8366  -16.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0515  -17.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4953  -16.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4942  -16.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2064  -17.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2046  -15.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9173  -15.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9162  -16.8224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6265  -17.2314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3425  -16.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3437  -15.9996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6288  -15.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6288  -14.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3198  -18.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6130  -18.0345    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8980  -18.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8894  -19.2608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3137  -19.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7714  -20.4726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5810  -20.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9134  -19.8178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5975  -19.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2021  -14.7669    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.0516  -15.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1943  -18.0238    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.7981  -15.9204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3451  -15.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9363  -14.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1367  -14.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8 11  2  0
 10  9  2  0
  9  6  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
  5 13  1  6
  1 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 21 17  1  0
 21 25  2  0
 25 22  1  0
 22 23  1  0
 23 24  2  0
 24 21  1  0
 20 25  1  0
  9 26  1  0
 14 27  1  0
 19 28  1  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4578696

    ---

Associated Targets(Human)

SU-DHL-6 (338 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PIK3CD Tclin PI3-kinase p110-delta subunit (6699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.45Molecular Weight (Monoisotopic): 437.1776AlogP: 3.80#Rotatable Bonds: 3
Polar Surface Area: 92.59Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.35CX Basic pKa: 3.74CX LogP: 3.84CX LogD: 3.84
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -0.74

References

1. Ma X, Fang F, Tao Q, Shen L, Zhong G, Qiao T, Lv X, Li J..  (2019)  Conformationally restricted quinazolone derivatives as PI3Kδ-selective inhibitors: the design, synthesis and biological evaluation.,  10  (3): [PMID:30996859] [10.1039/C8MD00556G]

Source