The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-2-(4-(furan-2-ylmethyl)-5-(thiophen-2-yl)-4H-1,2,4-triazol-3-ylthio)acetamide ID: ALA4578783
Cas Number: 585550-01-2
PubChem CID: 1034375
Max Phase: Preclinical
Molecular Formula: C21H18N4O4S2
Molecular Weight: 454.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nnc(-c2cccs2)n1Cc1ccco1)Nc1ccc2c(c1)OCCO2
Standard InChI: InChI=1S/C21H18N4O4S2/c26-19(22-14-5-6-16-17(11-14)29-9-8-28-16)13-31-21-24-23-20(18-4-2-10-30-18)25(21)12-15-3-1-7-27-15/h1-7,10-11H,8-9,12-13H2,(H,22,26)
Standard InChI Key: JYTVYKHADDASOT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
32.0960 -3.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0949 -4.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8029 -4.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8012 -2.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5098 -3.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5086 -4.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2187 -4.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9345 -4.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9357 -3.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2211 -2.9586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3869 -4.6036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6795 -4.1945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9714 -4.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6801 -3.3773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2641 -4.1933 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.5560 -4.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8139 -4.2696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2666 -4.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6747 -5.5846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4741 -5.4152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4540 -4.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0486 -4.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2491 -4.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1630 -5.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9093 -5.3990 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.6449 -3.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2528 -2.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0493 -3.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4587 -2.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9126 -1.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1657 -2.1132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
2 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
18 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
17 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.53Molecular Weight (Monoisotopic): 454.0769AlogP: 4.15#Rotatable Bonds: 7Polar Surface Area: 91.41Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.72CX Basic pKa: 0.71CX LogP: 3.13CX LogD: 3.13Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -2.81
References 1. Turku A, Borrel A, Leino TO, Karhu L, Kukkonen JP, Xhaard H.. (2016) Pharmacophore Model To Discover OX1 and OX2 Orexin Receptor Ligands., 59 (18): [PMID:27546834 ] [10.1021/acs.jmedchem.6b00333 ]