The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1r,4r)-4-(4-(5-(2-ethyl-4-methyloxazole-5-carboxamido)pyridin-2-yl)phenyl)cyclohexyl)acetic acid ID: ALA4578901
PubChem CID: 155565717
Max Phase: Preclinical
Molecular Formula: C26H29N3O4
Molecular Weight: 447.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc(C)c(C(=O)Nc2ccc(-c3ccc([C@H]4CC[C@H](CC(=O)O)CC4)cc3)nc2)o1
Standard InChI: InChI=1S/C26H29N3O4/c1-3-23-28-16(2)25(33-23)26(32)29-21-12-13-22(27-15-21)20-10-8-19(9-11-20)18-6-4-17(5-7-18)14-24(30)31/h8-13,15,17-18H,3-7,14H2,1-2H3,(H,29,32)(H,30,31)/t17-,18-
Standard InChI Key: RGZGIPKMQXYVRG-IYARVYRRSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
19.2432 -11.3258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9503 -10.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6553 -11.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3619 -10.9150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3611 -10.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6477 -9.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9441 -10.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0639 -9.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7731 -10.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4791 -9.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4772 -8.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7633 -8.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0602 -8.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1812 -8.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8905 -8.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5943 -8.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5951 -7.6368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8858 -7.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1758 -7.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3026 -7.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0105 -7.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7180 -7.2273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0109 -8.4534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5349 -10.9184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8278 -11.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5336 -10.1012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0818 -11.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5360 -11.6090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9457 -12.3161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7447 -12.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9091 -10.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6146 -13.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8020 -13.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
5 8 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
14 11 1 1
17 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
1 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 25 1 0
27 31 1 0
29 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.54Molecular Weight (Monoisotopic): 447.2158AlogP: 5.61#Rotatable Bonds: 7Polar Surface Area: 105.32Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.85CX Basic pKa: 3.58CX LogP: 4.02CX LogD: 1.69Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -1.16
References 1. Harrison TJ, Bauer D, Berdichevsky A, Chen X, Duvadie R, Hoogheem B, Hatsis P, Liu Q, Mao J, Miduturu V, Rocheford E, Zecri F, Zessis R, Zheng R, Zhu Q, Streeper R, Patel SJ.. (2019) Successful Strategies for Mitigation of a Preclinical Signal for Phototoxicity in a DGAT1 Inhibitor., 10 (8): [PMID:31413796 ] [10.1021/acsmedchemlett.9b00117 ]