2'-(1H-1,3-Benzodiazol-2-yl)-5'-methoxy-4-{[(1R)-1-phenylbutyl]carbamoyl}[1,1'-biphenyl]-2-carboxylic Acid

ID: ALA4578949

PubChem CID: 154603387

Max Phase: Preclinical

Molecular Formula: C32H29N3O4

Molecular Weight: 519.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC[C@@H](NC(=O)c1ccc(-c2cc(OC)ccc2-c2nc3ccccc3[nH]2)c(C(=O)O)c1)c1ccccc1

Standard InChI:  InChI=1S/C32H29N3O4/c1-3-9-27(20-10-5-4-6-11-20)35-31(36)21-14-16-23(26(18-21)32(37)38)25-19-22(39-2)15-17-24(25)30-33-28-12-7-8-13-29(28)34-30/h4-8,10-19,27H,3,9H2,1-2H3,(H,33,34)(H,35,36)(H,37,38)/t27-/m1/s1

Standard InChI Key:  VAFOVIXSICRGNP-HHHXNRCGSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    8.9629  -27.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9618  -28.0179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6739  -28.4269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3877  -28.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3849  -27.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6722  -26.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2531  -26.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542  -25.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5431  -25.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8345  -25.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8373  -26.7855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5449  -27.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1220  -25.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1208  -24.7311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9664  -25.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6779  -25.9606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9670  -24.7301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2496  -28.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4108  -25.9622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6984  -25.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6971  -24.7334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9872  -25.9644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2747  -25.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5635  -25.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4081  -24.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4072  -23.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6942  -23.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9807  -23.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9851  -24.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5019  -28.0963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1662  -29.2460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3627  -29.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9571  -28.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1377  -28.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7229  -29.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1376  -30.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9557  -30.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0952  -26.7753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8086  -27.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  1  7  1  0
 10 13  1  0
 13 14  2  0
  8 15  1  0
 15 16  1  0
 15 17  2  0
  2 18  1  0
 13 19  1  0
 19 20  1  0
 20 21  1  6
 20 22  1  0
 22 23  1  0
 23 24  1  0
 21 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 21  1  0
 18 30  2  0
 30 33  1  0
 32 31  1  0
 31 18  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
  5 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4578949

    ---

Associated Targets(Human)

APLNR Tchem Apelin receptor (3301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.60Molecular Weight (Monoisotopic): 519.2158AlogP: 6.87#Rotatable Bonds: 9
Polar Surface Area: 104.31Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.43CX Basic pKa: 5.12CX LogP: 5.21CX LogD: 3.33
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.20Np Likeness Score: -0.66

References

1. Su S, Clarke A, Han Y, Chao HJ, Bostwick J, Schumacher W, Wang T, Yan M, Hsu MY, Simmons E, Luk C, Xu C, Dabros M, Galella M, Onorato J, Gordon D, Wexler R, Gargalovic PS, Lawrence RM..  (2019)  Biphenyl Acid Derivatives as APJ Receptor Agonists.,  62  (22): [PMID:31724863] [10.1021/acs.jmedchem.9b01513]

Source