The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(4-hydroxyphenyl)-N-(2-morpholinoethyl)propanamide ID: ALA4579235
PubChem CID: 155565317
Max Phase: Preclinical
Molecular Formula: C23H28FN3O4
Molecular Weight: 429.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccc(F)cc1)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCN1CCOCC1
Standard InChI: InChI=1S/C23H28FN3O4/c24-19-5-1-18(2-6-19)16-22(29)26-21(15-17-3-7-20(28)8-4-17)23(30)25-9-10-27-11-13-31-14-12-27/h1-8,21,28H,9-16H2,(H,25,30)(H,26,29)/t21-/m0/s1
Standard InChI Key: RNWONFGJEVZELF-NRFANRHFSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
4.1721 -13.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1710 -14.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8790 -14.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5887 -14.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5858 -13.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8772 -13.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2970 -14.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0041 -14.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7124 -14.6702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4195 -14.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1279 -14.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8349 -14.2583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5433 -14.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2503 -14.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9587 -14.6635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9540 -15.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6583 -15.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3678 -15.4828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3685 -14.6647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6597 -14.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1291 -15.4852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4182 -13.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1253 -12.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8333 -13.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5399 -12.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5390 -12.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8257 -11.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1220 -12.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0028 -13.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4643 -13.0374 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.2456 -11.7186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
10 9 1 1
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
11 21 2 0
10 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
8 29 2 0
1 30 1 0
26 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.49Molecular Weight (Monoisotopic): 429.2064AlogP: 1.25#Rotatable Bonds: 9Polar Surface Area: 90.90Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.50CX Basic pKa: 6.07CX LogP: 1.79CX LogD: 1.76Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -1.12
References 1. Yao S, Wei B, Yu M, Meng X, He M, Yao R.. (2019) Design, synthesis and evaluation of PD176252 analogues for ameliorating cisplatin-induced nephrotoxicity., 10 (5): [PMID:31191866 ] [10.1039/C8MD00632F ]