(2S)-2-[[2-(4-fluorophenyl)acetyl]amino]-3-(4-hydroxyphenyl)-N-(2-morpholinoethyl)propanamide

ID: ALA4579235

PubChem CID: 155565317

Max Phase: Preclinical

Molecular Formula: C23H28FN3O4

Molecular Weight: 429.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(F)cc1)N[C@@H](Cc1ccc(O)cc1)C(=O)NCCN1CCOCC1

Standard InChI:  InChI=1S/C23H28FN3O4/c24-19-5-1-18(2-6-19)16-22(29)26-21(15-17-3-7-20(28)8-4-17)23(30)25-9-10-27-11-13-31-14-12-27/h1-8,21,28H,9-16H2,(H,25,30)(H,26,29)/t21-/m0/s1

Standard InChI Key:  RNWONFGJEVZELF-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    4.1721  -13.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1710  -14.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8790  -14.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5887  -14.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5858  -13.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8772  -13.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2970  -14.6724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0041  -14.2627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7124  -14.6702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4195  -14.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1279  -14.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8349  -14.2583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5433  -14.6658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2503  -14.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9587  -14.6635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9540  -15.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6583  -15.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3678  -15.4828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3685  -14.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6597  -14.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1291  -15.4852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4182  -13.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1253  -12.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8333  -13.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5399  -12.9473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5390  -12.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8257  -11.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1220  -12.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0028  -13.4455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4643  -13.0374    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.2456  -11.7186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  1
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 20  1  0
 11 21  2  0
 10 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
  8 29  2  0
  1 30  1  0
 26 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4579235

    ---

Associated Targets(Human)

HK-2 (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.49Molecular Weight (Monoisotopic): 429.2064AlogP: 1.25#Rotatable Bonds: 9
Polar Surface Area: 90.90Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.50CX Basic pKa: 6.07CX LogP: 1.79CX LogD: 1.76
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -1.12

References

1. Yao S, Wei B, Yu M, Meng X, He M, Yao R..  (2019)  Design, synthesis and evaluation of PD176252 analogues for ameliorating cisplatin-induced nephrotoxicity.,  10  (5): [PMID:31191866] [10.1039/C8MD00632F]

Source