The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(3-isopropyl-1H-pyrazol-5-yl)phenyl)-3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)benzamide ID: ALA4579447
PubChem CID: 155565320
Max Phase: Preclinical
Molecular Formula: C24H22F3N5O
Molecular Weight: 453.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cn(-c2cc(C(=O)Nc3cccc(-c4cc(C(C)C)n[nH]4)c3)cc(C(F)(F)F)c2)cn1
Standard InChI: InChI=1S/C24H22F3N5O/c1-14(2)21-11-22(31-30-21)16-5-4-6-19(8-16)29-23(33)17-7-18(24(25,26)27)10-20(9-17)32-12-15(3)28-13-32/h4-14H,1-3H3,(H,29,33)(H,30,31)
Standard InChI Key: WQPMEPNEGHISAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.8864 -14.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8853 -15.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5933 -16.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3030 -15.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3002 -14.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5915 -14.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1800 -16.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4337 -15.7889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8864 -16.3958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2944 -17.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0939 -16.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0113 -16.1176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7184 -15.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7171 -14.8907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9615 -17.8502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1488 -17.9350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4414 -18.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4235 -16.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4234 -16.9310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1309 -17.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8390 -16.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8351 -16.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1270 -15.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1331 -18.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1339 -18.9036 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.4717 -18.7002 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.7957 -18.6988 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.5394 -15.6905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2876 -16.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8313 -15.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4191 -14.7033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6207 -14.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6445 -15.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
2 7 1 0
4 12 1 0
12 13 1 0
13 14 2 0
10 15 1 0
15 16 1 0
15 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
13 18 1 0
24 25 1 0
24 26 1 0
24 27 1 0
20 24 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 28 1 0
22 28 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.47Molecular Weight (Monoisotopic): 453.1776AlogP: 5.97#Rotatable Bonds: 5Polar Surface Area: 75.60Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.91CX LogP: 5.08CX LogD: 5.07Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -1.91
References 1. Jung H, Kim J, Im D, Moon H, Hah JM.. (2019) Design, synthesis, and in vitro evaluation of N-(3-(3-alkyl-1H-pyrazol-5-yl) phenyl)-aryl amide for selective RAF inhibition., 29 (4): [PMID:30630714 ] [10.1016/j.bmcl.2019.01.003 ]