The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{4-[3-Fluoro-4-((3S,6R)-3-methyl-1,1-dioxo-6-phenyl-1lambda'6-[1,2]thiazinan-2-ylmethyl)-phenyl]-piperazin-1-yl}-ethanone ID: ALA4579711
PubChem CID: 122379290
Product Number: G610613, Order Now?
Max Phase: Preclinical
Molecular Formula: C24H30FN3O3S
Molecular Weight: 459.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCN(c2ccc(CN3[C@@H](C)CC[C@H](c4ccccc4)S3(=O)=O)c(F)c2)CC1
Standard InChI: InChI=1S/C24H30FN3O3S/c1-18-8-11-24(20-6-4-3-5-7-20)32(30,31)28(18)17-21-9-10-22(16-23(21)25)27-14-12-26(13-15-27)19(2)29/h3-7,9-10,16,18,24H,8,11-15,17H2,1-2H3/t18-,24+/m0/s1
Standard InChI Key: WLCIIQPUMOJJOF-MHECFPHRSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
8.1083 -1.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5250 -2.1708 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.9373 -1.4516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9610 -2.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9599 -3.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6747 -3.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3912 -3.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3883 -2.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6729 -2.1831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1012 -2.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8173 -2.5868 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8177 -3.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5296 -3.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2450 -3.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2439 -2.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1036 -3.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2451 -3.8351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5324 -3.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8198 -3.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8148 -4.6553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5288 -5.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2477 -4.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0985 -5.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3859 -4.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0947 -5.8894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6705 -1.3581 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.9580 -2.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6711 -2.5863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3846 -2.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3844 -1.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6646 -0.9363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9539 -1.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 2 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 2 1 0
12 16 1 6
5 17 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
9 26 1 0
15 27 1 1
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.59Molecular Weight (Monoisotopic): 459.1992AlogP: 3.55#Rotatable Bonds: 4Polar Surface Area: 60.93Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.32CX LogP: 2.87CX LogD: 2.87Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.70Np Likeness Score: -1.16
References 1. René O, Fauber BP, Barnard A, Chapman K, Deng Y, Eidenschenk C, Everett C, Gobbi A, Johnson AR, La H, Norman M, Salmon G, Summerhill S, Wong H.. (2016) Discovery of oxa-sultams as RORc inverse agonists showing reduced lipophilicity, improved selectivity and favorable ADME properties., 26 (18): [PMID:27524313 ] [10.1016/j.bmcl.2016.07.081 ]