(2-Methoxyphenyl) (2R)-(2-((3aS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborol-2-yl)pyrrolidin-1-yl)methanone

ID: ALA4579992

PubChem CID: 155565399

Max Phase: Preclinical

Molecular Formula: C22H30BNO4

Molecular Weight: 383.30

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1C(=O)N1CCC[C@H]1B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1

Standard InChI:  InChI=1S/C22H30BNO4/c1-21(2)14-12-17(21)22(3)18(13-14)27-23(28-22)19-10-7-11-24(19)20(25)15-8-5-6-9-16(15)26-4/h5-6,8-9,14,17-19H,7,10-13H2,1-4H3/t14-,17-,18+,19-,22-/m0/s1

Standard InChI Key:  KAXBHJYJLTYAPX-FQDUKEJRSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   10.1137  -10.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1126  -11.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8291  -11.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5431  -11.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5403  -10.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8273  -10.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2599  -11.8101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2612  -12.6364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9755  -11.3937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7275  -11.7258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2809  -11.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8645  -10.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0565  -10.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7195  -12.5485    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   13.0510  -13.0309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3836  -13.0440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1231  -13.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3015  -13.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8836  -14.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2870  -15.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5269  -14.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4737  -13.8150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9485  -13.8232    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.7070  -14.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1181  -15.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8694  -15.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4571  -15.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5367  -15.9426    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.0573  -14.5146    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2507  -10.1504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2477   -9.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  1  0
 10 14  1  1
 14 15  1  0
 15 18  1  0
 17 16  1  0
 16 14  1  0
 17 18  1  0
 17 21  1  0
 18 19  1  0
 19 20  1  0
 20 25  1  0
 25 21  1  0
 18 22  1  1
 17 23  1  1
 19 24  1  0
 25 24  1  0
 20 26  1  0
 20 27  1  0
 25 28  1  6
 19 29  1  6
  5 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4579992

    ---

Associated Targets(Human)

PREP Tchem Prolyl endopeptidase (1176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.30Molecular Weight (Monoisotopic): 383.2268AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Plescia J, Dufresne C, Janmamode N, Wahba AS, Mittermaier AK, Moitessier N..  (2020)  Discovery of covalent prolyl oligopeptidase boronic ester inhibitors.,  185  [PMID:31732257] [10.1016/j.ejmech.2019.111783]

Source