The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4aS,7aS)-methyl 7-((4-(3-methoxybenzyl)piperazin-1-yl)methyl)-2-isopropyl-1-oxo-2,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyridine-4-carboxylate dihydrochloride ID: ALA4580013
PubChem CID: 155565539
Max Phase: Preclinical
Molecular Formula: C26H37Cl2N3O4
Molecular Weight: 453.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=CN(C(C)C)C(=O)[C@@H]2C(CN3CCN(Cc4cccc(OC)c4)CC3)=CC[C@H]12.Cl.Cl
Standard InChI: InChI=1S/C26H35N3O4.2ClH/c1-18(2)29-17-23(26(31)33-4)22-9-8-20(24(22)25(29)30)16-28-12-10-27(11-13-28)15-19-6-5-7-21(14-19)32-3;;/h5-8,14,17-18,22,24H,9-13,15-16H2,1-4H3;2*1H/t22-,24-;;/m1../s1
Standard InChI Key: FBKREVAMKMSKIL-MACDPMPUSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
12.6128 -4.7360 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.2858 -2.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5764 -3.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5764 -2.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7951 -2.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3147 -2.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7951 -3.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5723 -1.7169 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5723 -4.1809 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.2858 -1.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9976 -0.8915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5739 -0.8915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7094 -1.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2762 -3.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2726 -4.5894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9895 -3.3580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9926 -2.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5425 -4.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7391 -4.5673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4865 -5.3486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1881 -3.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3847 -4.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1321 -4.9071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6830 -5.5185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3287 -5.0769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7777 -4.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0374 -3.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4873 -3.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6828 -3.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4315 -4.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9792 -4.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6961 -3.7686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6938 -4.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4049 -3.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7404 -2.3043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5399 -2.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2355 -5.9411 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 14 1 0
17 2 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 3 1 0
4 8 1 1
3 9 1 1
2 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
14 15 2 0
14 16 1 0
16 17 1 0
7 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
21 22 1 0
22 23 1 0
20 24 1 0
23 24 1 0
23 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
16 32 1 0
32 33 1 0
32 34 1 0
28 35 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.58Molecular Weight (Monoisotopic): 453.2628AlogP: 2.68#Rotatable Bonds: 7Polar Surface Area: 62.32Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.77CX LogP: 2.22CX LogD: 1.70Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -0.25
References 1. Zhang Z, Wang Y, Zhang Y, Li J, Huang W, Wang L.. (2019) The synthesis and biological evaluation of novel gardenamide A derivatives as multifunctional neuroprotective agents., 10 (7): [PMID:31391892 ] [10.1039/C9MD00211A ]