5-((4-(methylamino)-5-(4-methylthiazol-2-yl)pyrimidin-2-yl)amino)-3-(piperidin-3-yloxy)picolinonitrile

ID: ALA4580169

PubChem CID: 134508190

Max Phase: Preclinical

Molecular Formula: C20H22N8OS

Molecular Weight: 422.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNc1nc(Nc2cnc(C#N)c(OC3CCCNC3)c2)ncc1-c1nc(C)cs1

Standard InChI:  InChI=1S/C20H22N8OS/c1-12-11-30-19(26-12)15-10-25-20(28-18(15)22-2)27-13-6-17(16(7-21)24-8-13)29-14-4-3-5-23-9-14/h6,8,10-11,14,23H,3-5,9H2,1-2H3,(H2,22,25,27,28)

Standard InChI Key:  FVOCWJYOHJAZQF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   24.2791  -18.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9940  -19.0426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9905  -19.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7048  -20.2792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4195  -19.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4156  -19.0363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7007  -18.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1352  -20.2760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8485  -19.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5600  -20.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2728  -19.8616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2708  -19.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5502  -18.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8403  -19.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9836  -18.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6964  -18.2046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5449  -17.8005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2567  -17.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9687  -17.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6784  -17.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6773  -16.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9604  -16.1444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2444  -16.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6960  -17.8037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4080  -17.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1911  -17.8148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3840  -17.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9722  -18.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5248  -18.9715    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.0478  -16.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  3  0
 13 17  1  0
 17 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
  7 24  1  0
 24 25  1  0
  2  1  1  0
  1 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29  1  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4580169

    ---

Associated Targets(Human)

CHEK1 Tchem Serine/threonine-protein kinase Chk1 (6846 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.52Molecular Weight (Monoisotopic): 422.1637AlogP: 3.09#Rotatable Bonds: 6
Polar Surface Area: 120.67Molecular Species: BASEHBA: 10HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.35CX Basic pKa: 9.26CX LogP: 1.43CX LogD: 0.06
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: -1.44

References

1. Tong L, Song P, Jiang K, Xu L, Jin T, Wang P, Hu X, Fang S, Gao A, Zhou Y, Liu T, Li J, Hu Y..  (2019)  Discovery of (R)-5-((5-(1-methyl-1H-pyrazol-4-yl)-4-(methylamino)pyrimidin-2-yl)amino)-3-(piperidin-3-yloxy)picolinonitrile, a novel CHK1 inhibitor for hematologic malignancies.,  173  [PMID:30986571] [10.1016/j.ejmech.2019.03.062]

Source