(S)-((1R,5aS,6R,9aS)-1,5a-dimethyl-7-methylene-3-oxo-6-((E)-2-(2-oxo-2,5-dihydrofuran-3-yl)ethenyl)decahydro-1H-benzo[c]azepin-1-yl)methyl pyrrolidine-2-carboxylate

ID: ALA4580347

PubChem CID: 155565340

Max Phase: Preclinical

Molecular Formula: C25H34N2O5

Molecular Weight: 442.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1CC[C@H]2[C@@](C)(CCC(=O)N[C@@]2(C)COC(=O)[C@@H]2CCCN2)[C@@H]1/C=C/C1=CCOC1=O

Standard InChI:  InChI=1S/C25H34N2O5/c1-16-6-9-20-24(2,18(16)8-7-17-11-14-31-22(17)29)12-10-21(28)27-25(20,3)15-32-23(30)19-5-4-13-26-19/h7-8,11,18-20,26H,1,4-6,9-10,12-15H2,2-3H3,(H,27,28)/b8-7+/t18-,19+,20+,24+,25+/m1/s1

Standard InChI Key:  OLOTZDSWDWVPQN-ITAJTMSTSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   11.4283  -15.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8505  -15.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6390  -15.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1996  -15.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9049  -14.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9049  -13.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1996  -13.4548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4964  -13.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4943  -14.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8525  -13.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0499  -15.0199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0501  -13.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6958  -14.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7048  -15.4730    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8786  -14.2800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4902  -13.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1995  -12.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9071  -12.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9069  -11.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5644  -10.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3117  -10.1512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4944  -10.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2422  -10.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3423  -11.1787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6138  -13.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2455  -15.7743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6541  -16.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4713  -16.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2455  -17.1897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9533  -17.1418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7305  -16.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7305  -16.0720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9533  -15.8196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  7  1  0
  9  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  1  0
  9  2  1  0
  8 10  1  0
  2 11  1  0
 10 12  1  0
 11 13  1  0
 12 13  1  0
  9 14  1  1
 13 15  2  0
  8 16  1  6
  7 17  1  6
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  2  0
 20 24  2  0
  6 25  2  0
  2  3  1  1
  2  1  1  0
  1 26  1  0
 26 27  1  0
 28 27  1  6
 27 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4580347

    ---

Associated Targets(Human)

HK2 Tchem Hexokinase type II (81 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.56Molecular Weight (Monoisotopic): 442.2468AlogP: 2.58#Rotatable Bonds: 5
Polar Surface Area: 93.73Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.89CX Basic pKa: 7.45CX LogP: 2.24CX LogD: 1.91
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: 2.31

References

1. Wang W, Wu Y, Yang K, Wu C, Tang R, Li H, Chen L..  (2019)  Synthesis of novel andrographolide beckmann rearrangement derivatives and evaluation of their HK2-related anti-inflammatory activities.,  173  [PMID:31009914] [10.1016/j.ejmech.2019.04.022]

Source