1-(2-Fluorophenethyl)-2-imino-10-methyl-N-(3-morpholinopropyl)-5-oxo-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide

ID: ALA4580666

PubChem CID: 155561601

Max Phase: Preclinical

Molecular Formula: C28H31FN6O3

Molecular Weight: 518.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccn2c(=O)c3cc(C(=O)NCCCN4CCOCC4)c(=N)n(CCc4ccccc4F)c3nc12

Standard InChI:  InChI=1S/C28H31FN6O3/c1-19-6-4-12-35-25(19)32-26-22(28(35)37)18-21(27(36)31-10-5-11-33-14-16-38-17-15-33)24(30)34(26)13-9-20-7-2-3-8-23(20)29/h2-4,6-8,12,18,30H,5,9-11,13-17H2,1H3,(H,31,36)

Standard InChI Key:  RQHWLSHOYNVTER-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   26.0263   -6.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0263   -7.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7357   -7.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7357   -6.1372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4451   -6.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4462   -7.3712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1422   -7.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1401   -6.1382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8614   -6.5481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8616   -7.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5714   -7.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2854   -7.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2851   -6.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5708   -6.1360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7357   -5.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1415   -8.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9972   -6.1395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9968   -7.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9960   -8.6057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7091   -7.3724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.4205   -7.7858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1328   -7.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8401   -7.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5523   -7.3753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2618   -7.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9720   -7.3855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9770   -6.5639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2658   -6.1524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5495   -6.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5694   -5.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2805   -4.9007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2791   -4.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9914   -3.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9903   -2.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2778   -2.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5648   -2.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5694   -3.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8643   -4.0896    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  2  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  4 15  1  0
  7 16  2  0
 13 17  2  0
 12 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 14 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4580666

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.59Molecular Weight (Monoisotopic): 518.2442AlogP: 2.27#Rotatable Bonds: 8
Polar Surface Area: 104.72Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.50CX LogP: 1.84CX LogD: 1.43
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -1.83

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source