11-[(2R,8R,10S,11S)-2,8-Dihydroxy-7-oxo-11-((Z)-pent-2-enyl)-9-oxa-4-aza-tricyclo[6.3.1.0*1,5*]dodec-5-en-10-yl]-10-oxo-undecanoic acid

ID: ALA458077

PubChem CID: 44588272

Max Phase: Preclinical

Molecular Formula: C26H39NO7

Molecular Weight: 477.60

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC/C=C\C[C@@H]1[C@H](CC(=O)CCCCCCCCC(=O)O)O[C@]2(O)CC13C(=CC2=O)NC[C@@H]3O

Standard InChI:  InChI=1S/C26H39NO7/c1-2-3-8-12-19-20(14-18(28)11-9-6-4-5-7-10-13-24(31)32)34-26(33)17-25(19)21(15-22(26)29)27-16-23(25)30/h3,8,15,19-20,23,27,30,33H,2,4-7,9-14,16-17H2,1H3,(H,31,32)/b8-3-/t19-,20+,23+,25?,26-/m1/s1

Standard InChI Key:  SBRUOLULSOVEBY-KOOKXMNVSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   10.5162   -1.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2282   -1.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2282   -0.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5162    0.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8000    0.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2208    0.5875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5027    0.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0500   -0.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0844    0.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0821    1.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4988    1.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2114    2.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2075    3.0594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9278    1.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6403    2.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3567    1.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0692    2.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7856    1.8386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4982    2.2545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2146    1.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9271    2.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6435    1.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6488    1.0259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3575    2.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8042   -1.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8042   -0.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0152    0.0235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5275   -0.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0152   -1.3187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9421   -1.4760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2958    0.4375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3666    2.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6532    1.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9376    2.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15 16  1  0
  6  7  1  0
 16 17  1  0
  1  2  1  0
 17 18  1  0
  3  8  1  6
 18 19  1  0
  2  3  1  0
 19 20  1  0
  5  9  1  6
 20 21  1  0
  3  4  1  0
 21 22  1  0
  9 10  1  0
 22 23  1  0
 22 24  2  0
 25 26  1  0
  7 11  1  6
 26  5  1  0
 11 12  1  0
 26  4  1  0
 12 13  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
  3  6  1  0
  2 30  2  0
 12 14  1  0
 27 31  1  6
  5  7  1  0
 10 32  2  0
 14 15  1  0
 32 33  1  0
 25  1  2  0
 33 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA458077

   11-[(2R,8R,10S,11S)-2,8-dihydroxy-7-oxo-11-[(Z)-pent-2-enyl]-9-oxa-4-azatricyclo[6.3.1.01,5]dodec-5-en-10-yl]-10-oxoundecanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 477.60

Molecular Weight (Monoisotopic): 477.2727

AlogP: 3.02

#Rotatable Bonds: 14

Polar Surface Area: 133.16

Molecular Species: ACID

HBA: 7

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 4

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 5.02

CX Basic pKa: ┄

CX LogP: 3.22

CX LogD: 0.86

Aromatic Rings: ┄

Heavy Atoms: 34

QED Weighted: 0.22

Np Likeness Score: 1.61

References

1. Kai K, Takeuchi J, Kataoka T, Yokoyama M, Watanabe N..  (2008)  Structure and biological activity of novel FN analogs as flowering inducers.,  16  (23): [PMID:18952445] [10.1016/j.bmc.2008.10.014]

Source

Source(1):

• Scientific Literature