(R)-11-[(2R,8R,10S,11S)-2,8-Dihydroxy-7-oxo-11-((Z)-pent-2-enyl)-9-oxa-4-aza-tricyclo[6.3.1.0*1,5*]dodec-5-en-10-yl]-9-hydroxy-10-oxo-undecanoic acid methyl ester

ID: ALA458078

PubChem CID: 44588274

Max Phase: Preclinical

Molecular Formula: C27H41NO8

Molecular Weight: 507.62

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC/C=C\C[C@@H]1[C@H](CC(=O)[C@H](O)CCCCCCCC(=O)OC)O[C@]2(O)CC13C(=CC2=O)NC[C@@H]3O

Standard InChI:  InChI=1S/C27H41NO8/c1-3-4-8-11-18-21(14-20(30)19(29)12-9-6-5-7-10-13-25(33)35-2)36-27(34)17-26(18)22(15-23(27)31)28-16-24(26)32/h4,8,15,18-19,21,24,28-29,32,34H,3,5-7,9-14,16-17H2,1-2H3/b8-4-/t18-,19-,21+,24+,26?,27-/m1/s1

Standard InChI Key:  WXYGTMWQWIRIMJ-PSLLBRFOSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    9.6787   -7.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3907   -7.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3907   -6.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6787   -6.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9625   -5.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3833   -5.9375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6652   -5.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2125   -6.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2469   -5.5270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2446   -4.7020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6613   -4.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3739   -4.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3700   -3.4656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0903   -4.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8028   -4.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5192   -4.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2317   -4.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9481   -4.6864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6607   -4.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3771   -4.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0896   -4.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8060   -4.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8113   -5.4991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5200   -4.2583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -7.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9667   -6.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1777   -6.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6900   -7.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1777   -7.8437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1046   -8.0010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4583   -6.0875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5291   -4.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8157   -4.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1001   -4.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0941   -5.5247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0995   -5.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  1  2  1  0
 17 18  1  0
  3  8  1  6
 18 19  1  0
  2  3  1  0
 19 20  1  0
  5  9  1  6
 20 21  1  0
  3  4  1  0
 21 22  1  0
  9 10  1  0
 22 23  1  0
 22 24  2  0
 25 26  1  0
  7 11  1  6
 26  5  1  0
 11 12  1  0
 26  4  1  0
 12 13  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
  3  6  1  0
  2 30  2  0
 12 14  1  0
 27 31  1  6
  5  7  1  0
 10 32  2  0
 14 15  1  0
 32 33  1  0
 25  1  2  0
 33 34  1  0
 15 16  1  0
 14 35  1  1
  6  7  1  0
 23 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA458078

   methyl (9R)-11-[(2R,8R,10S,11S)-2,8-dihydroxy-7-oxo-11-[(Z)-pent-2-enyl]-9-oxa-4-azatricyclo[6.3.1.01,5]dodec-5-en-10-yl]-9-hydroxy-10-oxoundecanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 507.62

Molecular Weight (Monoisotopic): 507.2832

AlogP: 2.08

#Rotatable Bonds: 14

Polar Surface Area: 142.39

Molecular Species: NEUTRAL

HBA: 9

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 4

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 10.29

CX Basic pKa: ┄

CX LogP: 2.49

CX LogD: 2.49

Aromatic Rings: ┄

Heavy Atoms: 36

QED Weighted: 0.16

Np Likeness Score: 1.59

References

1. Kai K, Takeuchi J, Kataoka T, Yokoyama M, Watanabe N..  (2008)  Structure and biological activity of novel FN analogs as flowering inducers.,  16  (23): [PMID:18952445] [10.1016/j.bmc.2008.10.014]

Source

Source(1):

• Scientific Literature