4,4'-(((2R,3S,4R,5R,6R)-5-amino-6-((1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyloxy)-3,4-dihydroxytetrahydro-2H-pyran-2-yl)methylazanediyl)dibut-2-enal

ID: ALA4580827

PubChem CID: 155561482

Max Phase: Preclinical

Molecular Formula: C20H34N4O8

Molecular Weight: 458.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)O[C@H](CN(C/C=C/C=O)C/C=C/C=O)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C20H34N4O8/c21-11-9-12(22)19(18(30)15(11)27)32-20-14(23)17(29)16(28)13(31-20)10-24(5-1-3-7-25)6-2-4-8-26/h1-4,7-8,11-20,27-30H,5-6,9-10,21-23H2/b3-1+,4-2+/t11-,12+,13-,14-,15+,16-,17-,18-,19-,20-/m1/s1

Standard InChI Key:  RUAAFOFIZFIDNE-LMDKXKMKSA-N

Molfile:  

 
     RDKit          2D

 33 34  0  0  0  0  0  0  0  0999 V2000
   19.1010  -20.6728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0757  -19.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3543  -19.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6619  -19.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6873  -20.7203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4091  -21.1111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4386  -21.9317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7705  -19.4186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9375  -19.5137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8280  -21.0581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9896  -21.1535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2660  -20.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2480  -19.9435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5306  -19.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8332  -19.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8520  -20.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5764  -21.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6023  -22.0170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1077  -19.5922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5094  -18.7350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3021  -21.5862    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.1562  -21.2357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7881  -18.3475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0879  -18.7766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7669  -17.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0414  -17.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0203  -16.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2989  -15.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2777  -15.1056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3665  -18.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6705  -18.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9513  -18.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2557  -18.8550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  1
  2  8  1  1
  4  9  1  1
  1 10  1  6
  5 11  1  6
 11 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  6
 15 19  1  6
 14 20  1  1
 12 21  1  1
 16 22  1  1
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 24 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4580827

    ---

Associated Targets(non-human)

rev Protein Rev (94 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 458.51Molecular Weight (Monoisotopic): 458.2377AlogP: -4.26#Rotatable Bonds: 10
Polar Surface Area: 214.82Molecular Species: BASEHBA: 12HBD: 7
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 10#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.66CX Basic pKa: 9.15CX LogP: -4.48CX LogD: -7.48
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.12Np Likeness Score: 1.35

References

1. Simon B, Walmsley C, Jackson VJ, Garvey EP, Slater MJ, Berrisford DJ, Gardiner JM..  (2019)  Evaluation of neomycin analogues for HIV-1 RRE RNA recognition identifies enhanced activity simplified neamine analogues.,  29  (2): [PMID:30477891] [10.1016/j.bmcl.2018.11.004]

Source