The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4580886
PubChem CID: 155561182
Max Phase: Preclinical
Molecular Formula: C25H18FN3O5
Molecular Weight: 459.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c2c(=O)cc(-c3ccc(OCc4cn(-c5ccccc5F)nn4)cc3)oc2c1
Standard InChI: InChI=1S/C25H18FN3O5/c1-32-18-10-21(30)25-22(31)12-23(34-24(25)11-18)15-6-8-17(9-7-15)33-14-16-13-29(28-27-16)20-5-3-2-4-19(20)26/h2-13,30H,14H2,1H3
Standard InChI Key: ICLHAQGLHMMBSC-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
32.1084 -11.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8164 -11.5334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5247 -11.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5247 -12.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8190 -13.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1084 -12.7648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4004 -13.1766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4004 -13.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2328 -13.1713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9450 -12.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9450 -11.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2328 -11.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2328 -10.7130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6531 -13.1714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3614 -12.7639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0700 -13.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0700 -13.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3640 -14.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6531 -13.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7781 -14.3983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4861 -13.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1942 -14.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9408 -14.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4883 -14.6762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0810 -15.3838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2793 -15.2148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.3078 -14.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7199 -13.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5358 -13.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9437 -14.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5367 -15.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7221 -15.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3081 -13.2560 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.8164 -10.7139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
3 12 1 0
12 13 2 0
14 10 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
17 20 1 0
20 21 1 0
21 22 1 0
23 22 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 22 1 0
27 24 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
28 33 1 0
2 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.43Molecular Weight (Monoisotopic): 459.1230AlogP: 4.47#Rotatable Bonds: 6Polar Surface Area: 99.61Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.37CX Basic pKa: ┄CX LogP: 4.65CX LogD: 4.34Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.56
References 1. Xu Z, Zhao SJ, Liu Y.. (2019) 1,2,3-Triazole-containing hybrids as potential anticancer agents: Current developments, action mechanisms and structure-activity relationships., 183 [PMID:31546197 ] [10.1016/j.ejmech.2019.111700 ]