3-(3,5-Dibromophenyl)-N-[N'-(2-m-tolylacetyl)hydrazinocarbothioyl]acrylamide

ID: ALA4580895

PubChem CID: 89717804

Max Phase: Preclinical

Molecular Formula: C19H17Br2N3O2S

Molecular Weight: 511.24

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(CC(=O)NNC(=S)NC(=O)/C=C/c2cc(Br)cc(Br)c2)c1

Standard InChI:  InChI=1S/C19H17Br2N3O2S/c1-12-3-2-4-13(7-12)10-18(26)23-24-19(27)22-17(25)6-5-14-8-15(20)11-16(21)9-14/h2-9,11H,10H2,1H3,(H,23,26)(H2,22,24,25,27)/b6-5+

Standard InChI Key:  UKZDXZJGTMUDFI-AATRIKPKSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
    4.8247  -22.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5324  -22.4150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2401  -22.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9479  -22.4150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6556  -22.8236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3633  -22.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0710  -22.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1170  -22.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8247  -23.6408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3633  -21.5978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2401  -23.6408    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.4093  -22.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7016  -22.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7068  -21.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9999  -21.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2912  -21.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2938  -22.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0013  -22.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7787  -22.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4853  -22.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1925  -22.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1930  -21.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4803  -21.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7760  -21.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0003  -20.3710    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.5876  -22.8294    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   11.9000  -22.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  1  8  1  0
  1  9  2  0
  6 10  2  0
  3 11  2  0
  8 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  7 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 15 25  1  0
 17 26  1  0
 21 27  1  0
M  END

Associated Targets(Human)

SRR Tbio Serine racemase (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 511.24Molecular Weight (Monoisotopic): 508.9408AlogP: 3.80#Rotatable Bonds: 4
Polar Surface Area: 70.23Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.64CX Basic pKa: CX LogP: 5.17CX LogD: 5.17
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.33Np Likeness Score: -1.51

References

1.  (2014)  Serine racemase inhibitor, 

Source