The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((1S,2S,4R)-4-{[8-(2,3-dimethoxyphenyl)-9H-purin-6-yl]amino}-2-hydroxycyclopentyl)methyl sulfamate ID: ALA4581036
PubChem CID: 87157177
Max Phase: Preclinical
Molecular Formula: C19H24N6O6S
Molecular Weight: 464.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-c2nc3c(N[C@@H]4C[C@@H](COS(N)(=O)=O)[C@@H](O)C4)ncnc3[nH]2)c1OC
Standard InChI: InChI=1S/C19H24N6O6S/c1-29-14-5-3-4-12(16(14)30-2)17-24-15-18(21-9-22-19(15)25-17)23-11-6-10(13(26)7-11)8-31-32(20,27)28/h3-5,9-11,13,26H,6-8H2,1-2H3,(H2,20,27,28)(H2,21,22,23,24,25)/t10-,11+,13-/m0/s1
Standard InChI Key: IATMINVMLQNSTJ-LOWVWBTDSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
19.9853 -8.2755 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.1725 -8.1912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6942 -8.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8774 -8.7685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4664 -8.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6673 -8.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5830 -9.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3318 -9.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8012 -7.3144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8737 -9.4564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3908 -10.4358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9084 -11.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3918 -11.7589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1684 -11.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8784 -11.9114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5877 -11.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5869 -10.6859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8777 -10.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1684 -10.6867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0931 -11.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6821 -10.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8627 -10.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4534 -11.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8635 -11.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6837 -11.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4526 -9.6836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6332 -9.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0874 -9.6829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6773 -8.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3187 -9.0216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9799 -7.4579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7723 -8.0605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
4 8 1 0
5 9 1 6
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
11 19 1 0
14 19 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
26 27 1 0
22 26 1 0
28 29 1 0
21 28 1 0
12 20 1 0
10 18 1 0
7 10 1 1
4 3 1 6
2 3 1 0
1 30 1 0
1 31 2 0
1 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.50Molecular Weight (Monoisotopic): 464.1478AlogP: 0.81#Rotatable Bonds: 8Polar Surface Area: 174.57Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.87CX Basic pKa: 4.83CX LogP: -0.17CX LogD: -0.19Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -0.16
References 1. (2013) Inhibitors of nedd8-activating enzyme,