2-((5aS,6S,8S,9aS,10S)-6-acetoxy-10-hydroxy-5a-methyl-1-oxo-3-(pyridin-3-yl)-1,5a,6,7,8,9,9a,10-octahydropyrano[4,3-b]chromen-8-yl)propane-1,3-diyl diacetate

ID: ALA4581323

PubChem CID: 134188278

Max Phase: Preclinical

Molecular Formula: C27H31NO10

Molecular Weight: 529.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OCC(COC(C)=O)[C@@H]1C[C@H](OC(C)=O)[C@@]2(C)Oc3cc(-c4cccnc4)oc(=O)c3[C@@H](O)[C@@H]2C1

Standard InChI:  InChI=1S/C27H31NO10/c1-14(29)34-12-19(13-35-15(2)30)18-8-20-25(32)24-22(38-27(20,4)23(9-18)36-16(3)31)10-21(37-26(24)33)17-6-5-7-28-11-17/h5-7,10-11,18-20,23,25,32H,8-9,12-13H2,1-4H3/t18-,20-,23-,25-,27-/m0/s1

Standard InChI Key:  QSIIALBNMATAIA-SDIIZVJKSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   24.6807  -16.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1048  -17.2344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3928  -15.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1031  -16.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8177  -16.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8283  -15.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1180  -14.7653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3971  -15.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3928  -17.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6807  -17.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9749  -17.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9751  -18.4648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6871  -18.8732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3991  -18.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6863  -14.7512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2612  -18.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1154  -18.8708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5460  -18.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2624  -19.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5448  -17.6420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8297  -17.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8283  -16.4055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1158  -17.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5485  -20.1171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8334  -19.7057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1195  -20.1193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8321  -18.8807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3849  -16.8177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6765  -18.0594    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.5462  -14.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2562  -15.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9749  -14.8004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9848  -13.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2701  -13.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5543  -13.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1189  -19.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8351  -20.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4061  -20.1114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9650  -15.9989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  1  3  1  0
  9  2  1  0
  2  4  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  8 15  2  0
 12 16  1  1
 14 17  1  1
 16 18  1  0
 16 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 19 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
  9 28  1  1
 10 29  1  6
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
  6 30  1  0
 17 36  1  0
 36 37  1  0
 36 38  2  0
  1 39  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4581323

    ---

Associated Targets(Human)

SOAT2 Tchem Acyl coenzyme A:cholesterol acyltransferase 2 (288 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.54Molecular Weight (Monoisotopic): 529.1948AlogP: 2.59#Rotatable Bonds: 7
Polar Surface Area: 151.46Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.86CX Basic pKa: 4.21CX LogP: -0.20CX LogD: -0.20
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: 1.31

References

1.  (2016)  Class of tricyclic analogue, preparation method and use thereof, 

Source