The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((3-Bromo-4-fluorophenyl)amino)-N-(4-((6,7-dimethoxyquinolin-4-yl)oxy)-3-fluorophenyl)nicotinamide ID: ALA4581386
PubChem CID: 155561284
Max Phase: Preclinical
Molecular Formula: C29H21BrF2N4O4
Molecular Weight: 607.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nccc(Oc3ccc(NC(=O)c4cccnc4Nc4ccc(F)c(Br)c4)cc3F)c2cc1OC
Standard InChI: InChI=1S/C29H21BrF2N4O4/c1-38-26-14-19-23(15-27(26)39-2)33-11-9-24(19)40-25-8-6-17(13-22(25)32)36-29(37)18-4-3-10-34-28(18)35-16-5-7-21(31)20(30)12-16/h3-15H,1-2H3,(H,34,35)(H,36,37)
Standard InChI Key: SMBVLLXQVVMDKK-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
30.8166 -4.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8155 -5.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5235 -5.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5217 -4.1641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2303 -4.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2311 -5.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9396 -5.7954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6479 -5.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6432 -4.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9340 -4.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1088 -4.1645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1074 -5.8005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1068 -6.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1086 -3.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9297 -3.3419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6352 -2.9296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3405 -3.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0456 -2.9261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0417 -2.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3268 -1.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6247 -2.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7467 -1.6948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4571 -2.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4625 -2.9159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1604 -1.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8725 -2.0893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5747 -1.6770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5710 -0.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8589 -0.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1505 -0.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8784 -2.9065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5891 -3.3099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0083 -4.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9997 -3.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2893 -2.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3026 -4.5275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5961 -4.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9125 -1.7167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.7029 -2.8761 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
40.7195 -4.5162 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 11 1 0
2 12 1 0
12 13 1 0
11 14 1 0
10 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 25 1 0
23 24 2 0
25 26 1 0
25 30 2 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
26 31 1 0
31 32 1 0
32 37 2 0
36 33 2 0
33 34 1 0
34 35 2 0
35 32 1 0
36 37 1 0
21 38 1 0
34 39 1 0
33 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.41Molecular Weight (Monoisotopic): 606.0714AlogP: 7.48#Rotatable Bonds: 8Polar Surface Area: 94.60Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.83CX LogP: 7.58CX LogD: 7.57Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: -1.32
References 1. Qi B, Xu X, Yang Y, He H, Yue X.. (2019) Optimization and biological evaluation of nicotinamide derivatives as Aurora kinase inhibitors., 27 (17): [PMID:31307762 ] [10.1016/j.bmc.2019.07.016 ]