3-(((5-oxo-5,7,8,13-tetrahydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-3-yl)oxy)methyl)-4-phenyl-1,2,5-oxadiazole-2-oxide

ID: ALA4581424

PubChem CID: 155561591

Max Phase: Preclinical

Molecular Formula: C27H19N5O4

Molecular Weight: 477.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1c2cc(OCc3c(-c4ccccc4)no[n+]3[O-])ccc2nc2n1CCc1c-2[nH]c2ccccc12

Standard InChI:  InChI=1S/C27H19N5O4/c33-27-20-14-17(35-15-23-24(30-36-32(23)34)16-6-2-1-3-7-16)10-11-22(20)29-26-25-19(12-13-31(26)27)18-8-4-5-9-21(18)28-25/h1-11,14,28H,12-13,15H2

Standard InChI Key:  KZORWXMUUZXVTA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 42  0  0  0  0  0  0  0  0999 V2000
    7.8871   -7.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5948   -7.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1799   -7.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4727   -7.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4722   -8.3260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1849   -8.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8892   -8.3242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0492   -5.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7572   -6.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4669   -5.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4640   -5.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0503   -5.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7568   -4.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7576   -3.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3445   -4.6561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4662   -3.4350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3469   -3.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0561   -3.4326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0586   -2.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3537   -2.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6402   -3.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6479   -2.6138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8591   -3.6783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3839   -3.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8711   -2.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5473   -1.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7366   -1.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2507   -2.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5771   -2.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1752   -6.2865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8823   -5.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5934   -6.2826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3698   -7.3566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8529   -6.6952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3730   -6.0314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6274   -5.2549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  1  1  0
 12  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 13  2  0
 12 13  1  0
 12 15  1  0
 13 14  1  0
 14 18  1  0
 17 15  2  0
 14 16  2  0
 17 18  1  0
 17 21  1  0
 18 19  1  0
 19 20  1  0
 20 22  1  0
 21 22  2  0
 22 25  1  0
 24 23  1  0
 23 21  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 10 30  1  0
 30 31  1  0
 31 32  1  0
 32  2  1  0
  2 33  2  0
 33 34  1  0
 34 35  1  0
 35 32  2  0
 35 36  1  0
M  CHG  2  35   1  36  -1
M  END

Alternative Forms

  1. Parent:

    ALA4581424

    ---

Associated Targets(non-human)

Aorta (2975 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.48Molecular Weight (Monoisotopic): 477.1437AlogP: 3.97#Rotatable Bonds: 4
Polar Surface Area: 112.88Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.44CX Basic pKa: 4.71CX LogP: 2.15CX LogD: 2.15
Aromatic Rings: 6Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.38

References

1. Ma J, Chen L, Fan J, Cao W, Zeng G, Wang Y, Li Y, Zhou Y, Deng X..  (2019)  Dual-targeting Rutaecarpine-NO donor hybrids as novel anti-hypertensive agents by promoting release of CGRP.,  168  [PMID:30818175] [10.1016/j.ejmech.2019.02.037]

Source