The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(1-((1-(4-(Cyclobutylsulfonyl)phenyl)azetidin-3-yl)methyl)piperidin-4-yl)-1-cyclopentyl-1,2,3,4-tetrahydroisoquinoline ID: ALA4581439
PubChem CID: 132104582
Max Phase: Preclinical
Molecular Formula: C33H45N3O2S
Molecular Weight: 547.81
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccc(N2CC(CN3CCC(C4(C5CCCC5)NCCc5ccccc54)CC3)C2)cc1)C1CCC1
Standard InChI: InChI=1S/C33H45N3O2S/c37-39(38,30-9-5-10-30)31-14-12-29(13-15-31)36-23-25(24-36)22-35-20-17-28(18-21-35)33(27-7-2-3-8-27)32-11-4-1-6-26(32)16-19-34-33/h1,4,6,11-15,25,27-28,30,34H,2-3,5,7-10,16-24H2
Standard InChI Key: IKIGKYBUAHEXDC-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 45 0 0 0 0 0 0 0 0999 V2000
3.7103 -14.4747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2975 -13.8917 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4990 -13.6748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4965 -18.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4954 -18.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2097 -19.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9258 -18.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2079 -17.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9221 -18.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6296 -17.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6294 -16.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9154 -16.4304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2016 -16.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7811 -16.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1162 -15.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4940 -14.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7743 -15.2267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9519 -16.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3980 -17.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8161 -16.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0156 -16.6651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7906 -17.4647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3725 -18.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1795 -17.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9918 -17.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4152 -17.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4278 -16.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6033 -16.2486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5942 -17.0730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0268 -15.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2527 -14.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6770 -14.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8773 -14.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6564 -15.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2338 -15.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5212 -13.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2373 -12.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8348 -11.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1159 -12.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 4 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
13 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 26 1 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 2 1 0
2 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.81Molecular Weight (Monoisotopic): 547.3232AlogP: 5.39#Rotatable Bonds: 7Polar Surface Area: 52.65Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.96CX LogP: 5.56CX LogD: 2.37Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.50Np Likeness Score: -0.68
References 1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S.. (2019) Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction., 62 (13): [PMID:31244110 ] [10.1021/acs.jmedchem.9b00021 ]