7-(4-Methoxybenzyl)-6-(3,4,5-trimethoxyphenyl)-5,7-dihydro-4H-[1,2]oxazolo[5,4-e]isoindole

ID: ALA4581544

PubChem CID: 60148281

Max Phase: Preclinical

Molecular Formula: C26H26N2O5

Molecular Weight: 446.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2cc3c(c2-c2cc(OC)c(OC)c(OC)c2)CCc2cnoc2-3)cc1

Standard InChI:  InChI=1S/C26H26N2O5/c1-29-19-8-5-16(6-9-19)14-28-15-21-20(10-7-17-13-27-33-25(17)21)24(28)18-11-22(30-2)26(32-4)23(12-18)31-3/h5-6,8-9,11-13,15H,7,10,14H2,1-4H3

Standard InChI Key:  JXWDOVBKIROIIP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    3.2564  -18.1598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9617  -18.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6669  -17.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6669  -18.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4451  -18.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9261  -17.7518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4451  -17.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2603  -17.3404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9617  -16.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7880  -16.1359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9792  -16.0557    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6532  -16.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6974  -19.1861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1488  -19.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4007  -20.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2007  -20.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7485  -20.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4937  -19.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7433  -17.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1519  -17.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9674  -17.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3759  -16.3393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9673  -15.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1459  -15.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7410  -16.3407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4542  -21.5173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9082  -22.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5484  -20.2955    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8036  -21.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8535  -21.1769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1056  -21.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3749  -14.9224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1921  -14.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  1  1  0
  1  2  1  0
  2  4  1  0
  3  9  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  3  2  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  5 13  1  0
  6 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 16 26  1  0
 26 27  1  0
 17 28  1  0
 28 29  1  0
 15 30  1  0
 30 31  1  0
 23 32  1  0
 32 33  1  0
M  END

Associated Targets(Human)

Panel NCI-60 (60 carcinoma cell lines) (1088 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.50Molecular Weight (Monoisotopic): 446.1842AlogP: 4.99#Rotatable Bonds: 7
Polar Surface Area: 67.88Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.04CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -0.36

References

1. Spanò V, Pennati M, Parrino B, Carbone A, Montalbano A, Cilibrasi V, Zuco V, Lopergolo A, Cominetti D, Diana P, Cirrincione G, Barraja P, Zaffaroni N..  (2016)  Preclinical Activity of New [1,2]Oxazolo[5,4-e]isoindole Derivatives in Diffuse Malignant Peritoneal Mesothelioma.,  59  (15): [PMID:27428868] [10.1021/acs.jmedchem.6b00777]

Source