3-(4-methyl-2-(4-(naphthalen-2-yl)phenyl)morpholin-2-yloxy)propane-1-thiol hydrobromide

ID: ALA4581613

PubChem CID: 155561193

Max Phase: Preclinical

Molecular Formula: C24H28BrNO2S

Molecular Weight: 393.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Br.CN1CCOC(OCCCS)(c2ccc(-c3ccc4ccccc4c3)cc2)C1

Standard InChI:  InChI=1S/C24H27NO2S.BrH/c1-25-13-15-27-24(18-25,26-14-4-16-28)23-11-9-20(10-12-23)22-8-7-19-5-2-3-6-21(19)17-22;/h2-3,5-12,17,28H,4,13-16,18H2,1H3;1H

Standard InChI Key:  PIKMBEIYKKLBTI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   16.1396  -12.2592    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   15.6127   -9.9335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6170  -10.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3293  -10.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1961  -10.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1961  -11.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9080  -11.9919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6201  -11.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9080  -10.3419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9080  -12.8169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0450  -10.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7570  -10.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7532   -9.5126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0316   -9.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3227   -9.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4600   -9.0968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1774   -9.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8888   -9.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4535   -8.2753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8962   -9.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8920   -8.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1755   -8.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1713   -7.4657    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.1618   -7.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8795   -8.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5900   -7.8478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5841   -7.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8616   -6.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1541   -7.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8  3  1  0
  3  9  1  0
  7 10  1  0
  4 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  4  1  0
 16 17  2  0
 17 18  1  0
 18 25  2  0
 24 19  2  0
 19 16  1  0
 13 16  1  0
  2 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  END

Associated Targets(non-human)

Liver (4264 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Fdft1 Squalene synthetase (891 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 393.55Molecular Weight (Monoisotopic): 393.1763AlogP: 4.96#Rotatable Bonds: 6
Polar Surface Area: 21.70Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 10.18CX Basic pKa: 6.45CX LogP: 5.47CX LogD: 5.42
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: 0.06

References

1. Matralis AN, Kourounakis AP..  (2019)  Optimizing the Pharmacological Profile of New Bifunctional Antihyperlipidemic/Antioxidant Morpholine Derivatives.,  10  (1): [PMID:30655954] [10.1021/acsmedchemlett.8b00469]

Source