2-(2-(2-chlorophenoxy)acetamido)-4-(3,5-dimethylisoxazol-4-yl)benzoic acid

ID: ALA4581743

PubChem CID: 155561554

Max Phase: Preclinical

Molecular Formula: C20H17ClN2O5

Molecular Weight: 400.82

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1noc(C)c1-c1ccc(C(=O)O)c(NC(=O)COc2ccccc2Cl)c1

Standard InChI:  InChI=1S/C20H17ClN2O5/c1-11-19(12(2)28-23-11)13-7-8-14(20(25)26)16(9-13)22-18(24)10-27-17-6-4-3-5-15(17)21/h3-9H,10H2,1-2H3,(H,22,24)(H,25,26)

Standard InChI Key:  LSTPBCUWOCHEMX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   13.0819   -3.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0808   -4.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7888   -5.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4985   -4.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4956   -3.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7870   -3.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7846   -2.7732    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.2018   -3.5844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9110   -3.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6172   -3.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3264   -3.9850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6141   -2.7619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0326   -3.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7379   -3.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4435   -3.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4409   -2.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7267   -2.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0239   -2.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7383   -4.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0311   -5.2102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4465   -5.2082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7183   -1.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3715   -1.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1121   -0.2800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2986   -0.2884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0553   -1.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2811   -1.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1509   -1.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 19 20  2  0
 19 21  1  0
 14 19  1  0
 17 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 26 27  1  0
 23 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4581743

    ---

Associated Targets(Human)

TRPM4 Tchem Transient receptor potential cation channel subfamily M member 4 (31 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.82Molecular Weight (Monoisotopic): 400.0826AlogP: 4.33#Rotatable Bonds: 6
Polar Surface Area: 101.66Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.45CX Basic pKa: 1.40CX LogP: 3.98CX LogD: 0.59
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.64Np Likeness Score: -1.59

References

1. Delalande C, Awale M, Rubin M, Probst D, Ozhathil LC, Gertsch J, Abriel H, Reymond JL..  (2019)  Optimizing TRPM4 inhibitors in the MHFP6 chemical space.,  166  [PMID:30708257] [10.1016/j.ejmech.2019.01.048]

Source