The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(2-chlorophenoxy)acetamido)-4-(3,5-dimethylisoxazol-4-yl)benzoic acid ID: ALA4581743
PubChem CID: 155561554
Max Phase: Preclinical
Molecular Formula: C20H17ClN2O5
Molecular Weight: 400.82
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1noc(C)c1-c1ccc(C(=O)O)c(NC(=O)COc2ccccc2Cl)c1
Standard InChI: InChI=1S/C20H17ClN2O5/c1-11-19(12(2)28-23-11)13-7-8-14(20(25)26)16(9-13)22-18(24)10-27-17-6-4-3-5-15(17)21/h3-9H,10H2,1-2H3,(H,22,24)(H,25,26)
Standard InChI Key: LSTPBCUWOCHEMX-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
13.0819 -3.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0808 -4.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7888 -5.2277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4985 -4.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4956 -3.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7870 -3.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7846 -2.7732 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.2018 -3.5844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9110 -3.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6172 -3.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3264 -3.9850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6141 -2.7619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0326 -3.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7379 -3.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4435 -3.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4409 -2.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7267 -2.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0239 -2.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7383 -4.8006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0311 -5.2102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4465 -5.2082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7183 -1.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3715 -1.0511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1121 -0.2800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2986 -0.2884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0553 -1.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2811 -1.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1509 -1.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
19 20 2 0
19 21 1 0
14 19 1 0
17 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 22 2 0
26 27 1 0
23 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.82Molecular Weight (Monoisotopic): 400.0826AlogP: 4.33#Rotatable Bonds: 6Polar Surface Area: 101.66Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.45CX Basic pKa: 1.40CX LogP: 3.98CX LogD: 0.59Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.64Np Likeness Score: -1.59
References 1. Delalande C, Awale M, Rubin M, Probst D, Ozhathil LC, Gertsch J, Abriel H, Reymond JL.. (2019) Optimizing TRPM4 inhibitors in the MHFP6 chemical space., 166 [PMID:30708257 ] [10.1016/j.ejmech.2019.01.048 ]