2-Amino-N-[2-chloro-5-(2-{[3-(methylamino)piperidin-1-yl]methyl}-1,3-thiazol-5-yl)phenyl]-1,3-oxazole-4-carboxamide

ID: ALA4581822

PubChem CID: 135198573

Max Phase: Preclinical

Molecular Formula: C20H23ClN6O2S

Molecular Weight: 446.96

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC1CCCN(Cc2ncc(-c3ccc(Cl)c(NC(=O)c4coc(N)n4)c3)s2)C1

Standard InChI:  InChI=1S/C20H23ClN6O2S/c1-23-13-3-2-6-27(9-13)10-18-24-8-17(30-18)12-4-5-14(21)15(7-12)25-19(28)16-11-29-20(22)26-16/h4-5,7-8,11,13,23H,2-3,6,9-10H2,1H3,(H2,22,26)(H,25,28)

Standard InChI Key:  CCDHLWIXWILVTP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    7.6248   -8.3154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2245   -7.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7693   -6.9905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5163   -7.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4296   -8.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2097   -6.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2097   -6.0991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9278   -7.3372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6171   -6.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6171   -6.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3393   -5.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0575   -6.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0575   -6.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3393   -7.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7467   -7.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4917   -7.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0408   -7.6323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6087   -8.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8149   -8.1560    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.9294   -9.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7502   -9.1808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0710   -9.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8877  -10.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3675   -9.3534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0468   -8.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2301   -8.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2084  -10.7688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0251  -10.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9278   -5.6946    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.4156   -7.5106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  1  5  1  0
  4  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 13 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 19 15  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 26  1  0
 23 27  1  0
 27 28  1  0
 10 29  1  0
  2 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4581822

    ---

Associated Targets(Human)

PAICS Tchem Multifunctional protein ADE2 (310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.96Molecular Weight (Monoisotopic): 446.1292AlogP: 3.47#Rotatable Bonds: 6
Polar Surface Area: 109.31Molecular Species: BASEHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.86CX Basic pKa: 10.11CX LogP: 2.27CX LogD: -0.33
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.53Np Likeness Score: -1.73

References

1.  (2018)  Oxazole derivatives for use in the treatment of cancer, 

Source