The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sclerosporide ID: ALA4582129
PubChem CID: 155562018
Max Phase: Preclinical
Molecular Formula: C23H36O7
Molecular Weight: 424.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H]1[C@@H](O)[C@H](O)[C@H](OC(=O)C2=CC[C@H](C(C)C)[C@H]3C=C(C)CC[C@@H]23)[C@H](OC)[C@H]1O
Standard InChI: InChI=1S/C23H36O7/c1-11(2)13-8-9-15(14-7-6-12(3)10-16(13)14)23(27)30-22-18(25)17(24)20(28-4)19(26)21(22)29-5/h9-11,13-14,16-22,24-26H,6-8H2,1-5H3/t13-,14+,16-,17+,18+,19+,20-,21-,22+/m1/s1
Standard InChI Key: UFNLIQIFTAMKKF-XGGNSGRDSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
16.0992 -9.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3910 -10.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3922 -11.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0945 -11.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8028 -11.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8087 -10.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0980 -9.0497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6839 -11.4952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0922 -12.3143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5087 -11.5011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6832 -9.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5170 -9.8647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8051 -8.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9768 -11.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2649 -13.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2649 -14.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9702 -15.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9702 -13.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6755 -13.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6720 -14.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3741 -15.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0841 -14.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0876 -13.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3810 -13.5381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3695 -15.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6640 -15.5762 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.6682 -13.1287 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.5578 -15.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6595 -16.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0749 -16.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3833 -12.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6768 -12.3102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 6
3 8 1 6
4 9 1 6
5 10 1 6
2 11 1 1
6 12 1 1
7 13 1 0
8 14 1 0
15 16 1 0
15 18 1 0
16 17 2 0
17 20 1 0
19 18 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
21 25 1 6
20 26 1 6
19 27 1 6
16 28 1 0
25 29 1 0
25 30 1 0
24 31 1 0
31 9 1 0
31 32 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.53Molecular Weight (Monoisotopic): 424.2461AlogP: 1.60#Rotatable Bonds: 5Polar Surface Area: 105.45Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.56CX Basic pKa: ┄CX LogP: 2.04CX LogD: 2.04Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.45Np Likeness Score: 2.50
References 1. Dallery JF, Le Goff G, Adelin E, Iorga BI, Pigné S, O'Connell RJ, Ouazzani J.. (2019) Deleting a Chromatin Remodeling Gene Increases the Diversity of Secondary Metabolites Produced by Colletotrichum higginsianum., 82 (4): [PMID:30776231 ] [10.1021/acs.jnatprod.8b00796 ]