4-((3-Carbamoyl-2-methoxyphenyl)amino)-6-((5-fluoropyridin-2-yl)amino)-N-methyl-nicotinamide

ID: ALA4582205

PubChem CID: 90135056

Max Phase: Preclinical

Molecular Formula: C20H19FN6O3

Molecular Weight: 410.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cnc(Nc2ccc(F)cn2)cc1Nc1cccc(C(N)=O)c1OC

Standard InChI:  InChI=1S/C20H19FN6O3/c1-23-20(29)13-10-25-17(27-16-7-6-11(21)9-24-16)8-15(13)26-14-5-3-4-12(19(22)28)18(14)30-2/h3-10H,1-2H3,(H2,22,28)(H,23,29)(H2,24,25,26,27)

Standard InChI Key:  SHFGZSHVGYQOFV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    4.0391  -11.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0380  -12.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7460  -12.8260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4557  -12.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4529  -11.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7443  -11.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1641  -12.8240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8711  -12.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5761  -12.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2827  -12.4132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2819  -11.5951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5686  -11.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8649  -11.5992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9884  -11.1845    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.7418  -10.3714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3313  -11.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3311  -10.3719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6237  -11.5978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9159  -11.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4483   -9.9607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1551  -10.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8611   -9.9596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8591   -9.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1452   -8.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4421   -9.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7315   -8.7441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0268   -9.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1399   -7.9180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8449   -7.5048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4295   -7.5140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
  6 15  1  0
  1 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 15 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 25 26  1  0
 26 27  1  0
 24 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Associated Targets(Human)

JAK1 Tclin JAK1/TYK2 (259 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TYK2 Tclin Tyrosine-protein kinase TYK2 (5029 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.41Molecular Weight (Monoisotopic): 410.1503AlogP: 2.57#Rotatable Bonds: 7
Polar Surface Area: 131.26Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 13.03CX Basic pKa: 6.89CX LogP: 2.82CX LogD: 2.80
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.11

References

1. Wrobleski ST, Moslin R, Lin S, Zhang Y, Spergel S, Kempson J, Tokarski JS, Strnad J, Zupa-Fernandez A, Cheng L, Shuster D, Gillooly K, Yang X, Heimrich E, McIntyre KW, Chaudhry C, Khan J, Ruzanov M, Tredup J, Mulligan D, Xie D, Sun H, Huang C, D'Arienzo C, Aranibar N, Chiney M, Chimalakonda A, Pitts WJ, Lombardo L, Carter PH, Burke JR, Weinstein DS..  (2019)  Highly Selective Inhibition of Tyrosine Kinase 2 (TYK2) for the Treatment of Autoimmune Diseases: Discovery of the Allosteric Inhibitor BMS-986165.,  62  (20): [PMID:31318208] [10.1021/acs.jmedchem.9b00444]

Source