N-(3,4-dimethoxy-5-(3-(4-methylpiperazin-1-yl)propoxy)phenyl)-1-(4-methoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-6-amine

ID: ALA4582703

PubChem CID: 121230617

Max Phase: Preclinical

Molecular Formula: C28H35N7O4

Molecular Weight: 533.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2ncc3cnc(Nc4cc(OC)c(OC)c(OCCCN5CCN(C)CC5)c4)nc32)cc1

Standard InChI:  InChI=1S/C28H35N7O4/c1-33-11-13-34(14-12-33)10-5-15-39-25-17-21(16-24(37-3)26(25)38-4)31-28-29-18-20-19-30-35(27(20)32-28)22-6-8-23(36-2)9-7-22/h6-9,16-19H,5,10-15H2,1-4H3,(H,29,31,32)

Standard InChI Key:  PVQUVXVUIZZLMP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   12.0295   -6.9626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0283   -7.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7364   -8.1911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7346   -6.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2256   -8.0351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7088   -7.3697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2252   -6.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4432   -6.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4434   -7.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3203   -8.1902    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6129   -7.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4777   -8.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9294   -9.4181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1816  -10.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9818  -10.3649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5292   -9.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2741   -8.9783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6181   -6.9639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9115   -6.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2025   -6.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2045   -7.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9116   -8.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4979   -8.1949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5001   -9.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2090   -9.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2112  -10.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9200  -10.6426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9178  -11.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6225  -11.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3315  -11.4574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3313  -10.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6220  -10.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2356  -11.1416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6898  -11.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0388  -11.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4946   -6.5547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9126   -5.7377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6208   -5.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4941   -5.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  9  2  0
  8  4  2  0
  4  1  1  0
  8  9  1  0
  6  7  2  0
  5  6  1  0
  7  8  1  0
  9  5  1  0
  2 10  1  0
 10 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  5 12  1  0
 11 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 11  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 15 33  1  0
 33 34  1  0
 30 35  1  0
 20 36  1  0
 19 37  1  0
 37 38  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4582703

    ---

Associated Targets(Human)

TBK1 Tchem Serine/threonine-protein kinase TBK1 (3746 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.63Molecular Weight (Monoisotopic): 533.2751AlogP: 3.60#Rotatable Bonds: 11
Polar Surface Area: 99.03Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.20CX Basic pKa: 8.07CX LogP: 2.94CX LogD: 2.18
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.34

References

1. Sintim HO, Mikek CG, Wang M, Sooreshjani MA..  (2019)  Interrupting cyclic dinucleotide-cGAS-STING axis with small molecules.,  10  (12): [PMID:32206239] [10.1039/C8MD00555A]

Source