The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,4-dimethoxy-5-(3-(4-methylpiperazin-1-yl)propoxy)phenyl)-1-(4-methoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-6-amine ID: ALA4582703
PubChem CID: 121230617
Max Phase: Preclinical
Molecular Formula: C28H35N7O4
Molecular Weight: 533.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2ncc3cnc(Nc4cc(OC)c(OC)c(OCCCN5CCN(C)CC5)c4)nc32)cc1
Standard InChI: InChI=1S/C28H35N7O4/c1-33-11-13-34(14-12-33)10-5-15-39-25-17-21(16-24(37-3)26(25)38-4)31-28-29-18-20-19-30-35(27(20)32-28)22-6-8-23(36-2)9-7-22/h6-9,16-19H,5,10-15H2,1-4H3,(H,29,31,32)
Standard InChI Key: PVQUVXVUIZZLMP-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
12.0295 -6.9626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0283 -7.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7364 -8.1911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7346 -6.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2256 -8.0351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7088 -7.3697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2252 -6.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4432 -6.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4434 -7.7813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3203 -8.1902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6129 -7.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4777 -8.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9294 -9.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1816 -10.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9818 -10.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5292 -9.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2741 -8.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6181 -6.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9115 -6.5549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2025 -6.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2045 -7.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9116 -8.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4979 -8.1949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5001 -9.0121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2090 -9.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2112 -10.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9200 -10.6426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9178 -11.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6225 -11.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3315 -11.4574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3313 -10.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6220 -10.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2356 -11.1416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6898 -11.7498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0388 -11.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4946 -6.5547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9126 -5.7377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6208 -5.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4941 -5.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 9 2 0
8 4 2 0
4 1 1 0
8 9 1 0
6 7 2 0
5 6 1 0
7 8 1 0
9 5 1 0
2 10 1 0
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
5 12 1 0
11 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 11 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
15 33 1 0
33 34 1 0
30 35 1 0
20 36 1 0
19 37 1 0
37 38 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.63Molecular Weight (Monoisotopic): 533.2751AlogP: 3.60#Rotatable Bonds: 11Polar Surface Area: 99.03Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.20CX Basic pKa: 8.07CX LogP: 2.94CX LogD: 2.18Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.29Np Likeness Score: -1.34
References 1. Sintim HO, Mikek CG, Wang M, Sooreshjani MA.. (2019) Interrupting cyclic dinucleotide-cGAS-STING axis with small molecules., 10 (12): [PMID:32206239 ] [10.1039/C8MD00555A ]