(4-(7-methylquinazolin-4-yl)piperidin-1-yl)(4-(trifluoromethoxy)phenyl)methanone

ID: ALA4582824

PubChem CID: 139466461

Max Phase: Preclinical

Molecular Formula: C22H20F3N3O2

Molecular Weight: 415.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2c(C3CCN(C(=O)c4ccc(OC(F)(F)F)cc4)CC3)ncnc2c1

Standard InChI:  InChI=1S/C22H20F3N3O2/c1-14-2-7-18-19(12-14)26-13-27-20(18)15-8-10-28(11-9-15)21(29)16-3-5-17(6-4-16)30-22(23,24)25/h2-7,12-13,15H,8-11H2,1H3

Standard InChI Key:  CFRVHYHQRMOOKF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   12.8054  -14.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8042  -15.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5123  -15.4220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2219  -15.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2191  -14.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5105  -13.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0962  -15.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3888  -15.0119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0956  -16.2383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3859  -16.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3833  -17.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0888  -17.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7987  -17.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8029  -16.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9253  -13.7786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9222  -12.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6284  -12.5502    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.2129  -12.5555    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.9158  -12.1423    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.0851  -18.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0764  -20.3167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7883  -19.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7889  -19.0919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3700  -19.9040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3761  -19.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6741  -18.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9655  -19.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9634  -19.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6660  -20.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2547  -20.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  5 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
 12 20  1  0
 20 25  2  0
 24 21  2  0
 21 22  1  0
 22 23  2  0
 23 20  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4582824

    ---

Associated Targets(Human)

MAPK7 Tchem Mitogen-activated protein kinase 7 (929 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.42Molecular Weight (Monoisotopic): 415.1508AlogP: 4.86#Rotatable Bonds: 3
Polar Surface Area: 55.32Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.25CX LogP: 5.07CX LogD: 5.07
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.61Np Likeness Score: -1.35

References

1. Nguyen D, Lemos C, Wortmann L, Eis K, Holton SJ, Boemer U, Moosmayer D, Eberspaecher U, Weiske J, Lechner C, Prechtl S, Suelzle D, Siegel F, Prinz F, Lesche R, Nicke B, Nowak-Reppel K, Himmel H, Mumberg D, von Nussbaum F, Nising CF, Bauser M, Haegebarth A..  (2019)  Discovery and Characterization of the Potent and Highly Selective (Piperidin-4-yl)pyrido[3,2- d]pyrimidine Based in Vitro Probe BAY-885 for the Kinase ERK5.,  62  (2): [PMID:30563338] [10.1021/acs.jmedchem.8b01606]

Source