The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6-chloro-1-(4-methoxyphenyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-2(9H)-yl)(4-methoxyphenyl)methanone ID: ALA4582890
PubChem CID: 117937396
Max Phase: Preclinical
Molecular Formula: C26H23ClN2O3
Molecular Weight: 446.93
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2c2ccc(OC)cc2)cc1
Standard InChI: InChI=1S/C26H23ClN2O3/c1-31-19-8-3-16(4-9-19)25-24-21(22-15-18(27)7-12-23(22)28-24)13-14-29(25)26(30)17-5-10-20(32-2)11-6-17/h3-12,15,25,28H,13-14H2,1-2H3
Standard InChI Key: IYIPQDMNHILAIE-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
16.0890 -4.2846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7902 -3.8688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7784 -3.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0654 -2.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1005 -5.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3966 -5.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4069 -6.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1204 -6.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8250 -6.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8112 -5.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3806 -3.8892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3659 -3.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6127 -4.1541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1233 -3.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5890 -2.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2475 -2.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4406 -2.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9764 -2.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3205 -3.4370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5032 -4.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5139 -5.0852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1322 -7.5505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4305 -7.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0941 -1.2991 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.2055 -3.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9147 -4.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6166 -3.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6063 -3.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8883 -2.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1894 -3.0362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3080 -2.5971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2963 -1.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 4 1 0
11 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 5 1 0
11 12 2 0
12 15 1 0
14 13 1 0
13 11 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
2 20 1 0
20 21 2 0
8 22 1 0
22 23 1 0
17 24 1 0
20 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.93Molecular Weight (Monoisotopic): 446.1397AlogP: 5.63#Rotatable Bonds: 4Polar Surface Area: 54.56Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.13CX LogD: 5.13Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.74
References 1. Tikhmyanova N, Paparoidamis N, Romero-Masters J, Feng X, Mohammed FS, Reddy PAN, Kenney SC, Lieberman PM, Salvino JM.. (2019) Development of a novel inducer for EBV lytic therapy., 29 (16): [PMID:31255485 ] [10.1016/j.bmcl.2019.06.034 ]