2-((4-(3-(4-(2-Ethyl-2-hydroxybutoxy)-3-methylphenyl)pentan-3-yl)-2-methylphenoxy)methyl)propane-1,3-diol

ID: ALA4583069

PubChem CID: 155566184

Max Phase: Preclinical

Molecular Formula: C29H44O5

Molecular Weight: 472.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(O)(CC)COc1ccc(C(CC)(CC)c2ccc(OCC(CO)CO)c(C)c2)cc1C

Standard InChI:  InChI=1S/C29H44O5/c1-7-28(32,8-2)20-34-27-14-12-25(16-22(27)6)29(9-3,10-4)24-11-13-26(21(5)15-24)33-19-23(17-30)18-31/h11-16,23,30-32H,7-10,17-20H2,1-6H3

Standard InChI Key:  JUEOQFVJRIRRSF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
   29.0243   -9.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6159   -9.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4408   -9.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3305   -8.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0500   -7.6656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8924   -6.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8918   -6.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6876   -7.6301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1897   -8.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1885   -9.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9033   -9.8066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6198   -9.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6168   -8.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9015   -8.1537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0457   -8.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0455   -9.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7608   -9.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4745   -9.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4688   -8.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7531   -8.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9031  -10.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7635  -10.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1911   -9.7833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4737   -9.8057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7595   -9.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0448   -9.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3307   -9.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6159   -9.8034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9035   -9.3673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6242  -10.6011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6077   -8.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8573  -10.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0442  -10.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3294  -11.0414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 13  4  1  0
  4 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 11 21  1  0
 17 22  1  0
 18 23  1  0
 10 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 23 29  1  0
 29  2  1  0
  2 30  1  0
  1 31  1  0
  3 32  1  0
 26 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4583069

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.67Molecular Weight (Monoisotopic): 472.3189AlogP: 5.32#Rotatable Bonds: 14
Polar Surface Area: 79.15Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.98CX Basic pKa: CX LogP: 5.98CX LogD: 5.98
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: 0.10

References

1. Misawa T, Tsuji G, Takahashi T, Ochiai E, Takagi KI, Horie K, Kakuda S, Takimoto-Kamimura M, Kurihara M, Demizu Y..  (2018)  Structural development of non-secosteroidal vitamin D receptor (VDR) ligands without any asymmetric carbon.,  26  (23-24): [PMID:30446437] [10.1016/j.bmc.2018.11.008]

Source