The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4alpha-(6-bromopyridine-2-acyl)-4-desoxy-podophyllotoxin ID: ALA4583480
PubChem CID: 155561738
Max Phase: Preclinical
Molecular Formula: C28H24BrNO9
Molecular Weight: 598.40
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)c3cccc(Br)n3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC
Standard InChI: InChI=1S/C28H24BrNO9/c1-33-20-7-13(8-21(34-2)26(20)35-3)23-14-9-18-19(38-12-37-18)10-15(14)25(16-11-36-28(32)24(16)23)39-27(31)17-5-4-6-22(29)30-17/h4-10,16,23-25H,11-12H2,1-3H3/t16-,23+,24-,25-/m0/s1
Standard InChI Key: CCDBRLHAQUXQMV-RGWZMNCVSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
30.0864 -17.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0851 -16.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8003 -16.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7993 -17.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5155 -17.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5172 -16.2916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3718 -17.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3727 -16.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5882 -16.4554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1005 -17.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5826 -17.7956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2368 -16.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2344 -17.5414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0199 -17.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5099 -17.1309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0279 -16.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5166 -18.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8007 -19.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7996 -20.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5141 -20.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2264 -20.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2249 -19.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5173 -15.4720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8029 -15.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8029 -14.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0884 -15.4720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5142 -21.2488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7997 -21.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9416 -20.4212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9430 -21.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0847 -20.4229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0837 -21.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2735 -18.5879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2344 -18.3656 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.2368 -15.8889 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.5221 -13.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5225 -13.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8085 -12.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0927 -13.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0958 -13.8272 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3784 -12.5942 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
7 1 1 0
1 4 2 0
3 2 2 0
2 8 1 0
3 4 1 0
3 6 1 0
4 5 1 0
5 13 1 0
12 6 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
12 16 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
5 17 1 6
6 23 1 6
23 24 1 0
24 25 1 0
24 26 2 0
20 27 1 0
27 28 1 0
21 29 1 0
29 30 1 0
19 31 1 0
31 32 1 0
14 33 2 0
13 34 1 1
12 35 1 6
25 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 25 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.40Molecular Weight (Monoisotopic): 597.0634AlogP: 4.43#Rotatable Bonds: 6Polar Surface Area: 111.64Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.06CX LogD: 4.06Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: 0.86
References 1. Zhang L, Chen F, Zhang Z, Chen Y, Lin Y, Wang J.. (2016) Design, synthesis and evaluation of the multidrug resistance-reversing activity of pyridine acid esters of podophyllotoxin in human leukemia cells., 26 (18): [PMID:27503681 ] [10.1016/j.bmcl.2016.07.072 ]