Benzyl 4-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)amino)benzoate

ID: ALA4583712

PubChem CID: 117599696

Max Phase: Preclinical

Molecular Formula: C20H14N4O5

Molecular Weight: 390.36

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(OCc1ccccc1)c1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1

Standard InChI:  InChI=1S/C20H14N4O5/c25-20(28-12-13-4-2-1-3-5-13)14-6-8-15(9-7-14)21-16-10-11-17(24(26)27)19-18(16)22-29-23-19/h1-11,21H,12H2

Standard InChI Key:  OMUCPLAJAGAINM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   26.5944   -2.5011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5933   -3.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3013   -3.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2996   -2.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2971   -1.2750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0036   -0.8643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5882   -0.8685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0082   -2.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0084   -3.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7914   -3.5748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2751   -2.9087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7910   -2.2429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3016   -4.5468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5940   -4.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8902   -4.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1831   -4.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1829   -5.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8957   -6.1781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5999   -5.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4758   -6.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7675   -5.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4771   -6.9968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0604   -6.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3520   -5.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3524   -4.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6449   -4.5492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9369   -4.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9408   -5.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6489   -6.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  9  1  0
  8  4  1  0
  4  1  2  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12  8  2  0
  3 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
M  CHG  2   5   1   6  -1
M  END

Associated Targets(Human)

HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Daudi (625 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.36Molecular Weight (Monoisotopic): 390.0964AlogP: 4.23#Rotatable Bonds: 6
Polar Surface Area: 120.39Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.29Np Likeness Score: -1.29

References

1.  (2014)  Potent analogues of the c-myc inhibitor 10074-g5 with improved cell permeability, 
2. Mancini RS, Barden CJ, Weaver DF, Reed MA..  (2021)  Furazans in Medicinal Chemistry.,  64  (4.0): [PMID:33569941] [10.1021/acs.jmedchem.0c01901]