The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-O,O-dibenzyl-6-[(4-(2-chloro-4-fluorobenzenesulfonamide)methyl-1,2,3-triazol-1-yl]-6-deoxy-L-ascorbic acid ID: ALA4584107
PubChem CID: 155566073
Max Phase: Preclinical
Molecular Formula: C29H26ClFN4O7S
Molecular Weight: 629.07
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O[C@H]([C@@H](O)Cn2cc(CNS(=O)(=O)c3ccc(Cl)cc3F)nn2)C(OCc2ccccc2)=C1OCc1ccccc1
Standard InChI: InChI=1S/C29H26ClFN4O7S/c30-21-11-12-25(23(31)13-21)43(38,39)32-14-22-15-35(34-33-22)16-24(36)26-27(40-17-19-7-3-1-4-8-19)28(29(37)42-26)41-18-20-9-5-2-6-10-20/h1-13,15,24,26,32,36H,14,16-18H2/t24-,26+/m0/s1
Standard InChI Key: KIYRWOXQHACATE-AZGAKELHSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
22.6048 -3.0087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4220 -3.0087 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.0134 -2.3010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1495 -5.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3240 -5.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3889 -4.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0640 -4.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7203 -3.9671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3706 -4.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1689 -4.1776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6365 -5.8822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8535 -5.8987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6608 -4.4088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7144 -2.7785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4078 -3.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1012 -3.6452 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.9283 -3.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7471 -1.9619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9777 -1.6790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4756 -2.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6561 -2.3154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0333 -5.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6204 -6.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4507 -5.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8601 -6.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4494 -7.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8581 -8.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6761 -8.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0838 -7.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6728 -6.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8058 -6.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3929 -7.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7973 -8.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6187 -8.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0278 -7.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2412 -3.0194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0092 -3.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1927 -3.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7779 -4.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1803 -5.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0017 -5.1306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4128 -4.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2300 -4.4317 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.7664 -5.8306 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 4 1 0
7 5 1 0
8 6 1 0
9 7 1 0
10 6 2 0
11 4 1 0
12 5 1 0
9 13 1 1
14 15 1 0
15 9 1 0
7 16 1 6
7 8 1 0
17 14 1 0
14 18 1 0
18 19 2 0
19 20 1 0
20 17 2 0
20 21 1 0
12 22 1 0
22 23 1 0
11 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
23 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 23 1 0
21 36 1 0
36 2 1 0
2 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
42 43 1 0
40 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 629.07Molecular Weight (Monoisotopic): 628.1195AlogP: 3.48#Rotatable Bonds: 13Polar Surface Area: 141.87Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.17CX Basic pKa: 0.15CX LogP: 3.68CX LogD: 3.62Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.21Np Likeness Score: -0.93
References 1. Macan AM, Harej A, Cazin I, Klobučar M, Stepanić V, Pavelić K, Pavelić SK, Schols D, Snoeck R, Andrei G, Raić-Malić S.. (2019) Antitumor and antiviral activities of 4-substituted 1,2,3-triazolyl-2,3-dibenzyl-L-ascorbic acid derivatives., 184 [PMID:31586832 ] [10.1016/j.ejmech.2019.111739 ]