N,N'-(Propane-1,3-diyl)bis(4-(2-((S)-2-hydroxy-3-(isopropylamino)propoxy)phenyl)butanamide)

ID: ALA4584173

PubChem CID: 155565922

Max Phase: Preclinical

Molecular Formula: C35H56N4O6

Molecular Weight: 628.86

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)NC[C@H](O)COc1ccccc1CCCC(=O)NCCCNC(=O)CCCc1ccccc1OC[C@@H](O)CNC(C)C

Standard InChI:  InChI=1S/C35H56N4O6/c1-26(2)38-22-30(40)24-44-32-16-7-5-12-28(32)14-9-18-34(42)36-20-11-21-37-35(43)19-10-15-29-13-6-8-17-33(29)45-25-31(41)23-39-27(3)4/h5-8,12-13,16-17,26-27,30-31,38-41H,9-11,14-15,18-25H2,1-4H3,(H,36,42)(H,37,43)/t30-,31-/m0/s1

Standard InChI Key:  CEWLLKDQQHYNFQ-CONSDPRKSA-N

Molfile:  

 
     RDKit          2D

 45 46  0  0  0  0  0  0  0  0999 V2000
   30.7407  -27.0908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7400  -27.9075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4491  -28.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1555  -27.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1484  -27.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4387  -26.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4309  -25.8601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1347  -25.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1270  -24.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8308  -24.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4154  -24.2258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8230  -23.3952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5268  -22.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5191  -22.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2384  -23.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4213  -27.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4202  -27.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1282  -28.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8379  -27.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8351  -27.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1264  -26.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1240  -25.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8305  -25.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8280  -24.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5345  -24.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1191  -24.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5412  -26.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5321  -23.4505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2386  -23.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2361  -22.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9475  -23.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2505  -27.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9566  -26.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6659  -27.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3720  -26.7068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6689  -27.9353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0813  -27.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7874  -26.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4967  -27.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2028  -26.6962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9121  -27.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6183  -26.6909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9152  -27.9193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3275  -27.0968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0337  -26.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  1
 10 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  1
 20 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
 27 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 41 43  2  0
 42 44  1  0
 44 45  1  0
 45  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4584173

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 628.86Molecular Weight (Monoisotopic): 628.4200AlogP: 3.13#Rotatable Bonds: 24
Polar Surface Area: 141.18Molecular Species: BASEHBA: 8HBD: 6
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.77CX Basic pKa: 9.97CX LogP: 2.96CX LogD: -1.49
Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.10Np Likeness Score: -0.34

References

1. Gaiser BI, Danielsen M, Marcher-Rørsted E, Røpke Jørgensen K, Wróbel TM, Frykman M, Johansson H, Bräuner-Osborne H, Gloriam DE, Mathiesen JM, Sejer Pedersen D..  (2019)  Probing the Existence of a Metastable Binding Site at the β2-Adrenergic Receptor with Homobivalent Bitopic Ligands.,  62  (17): [PMID:31298548] [10.1021/acs.jmedchem.9b00595]

Source